The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cis-3-chloro-N-methyl-N-((1R,3S)-3-(5-(4-methyl-1H-imidazol-5-yl)-4H-1,2,4-triazol-3-yl)cyclohexyl)benzamide ID: ALA4791131
PubChem CID: 162670944
Max Phase: Preclinical
Molecular Formula: C20H23ClN6O
Molecular Weight: 398.90
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc[nH]c1-c1nnc([C@H]2CCC[C@@H](N(C)C(=O)c3cccc(Cl)c3)C2)[nH]1
Standard InChI: InChI=1S/C20H23ClN6O/c1-12-17(23-11-22-12)19-24-18(25-26-19)13-5-4-8-16(10-13)27(2)20(28)14-6-3-7-15(21)9-14/h3,6-7,9,11,13,16H,4-5,8,10H2,1-2H3,(H,22,23)(H,24,25,26)/t13-,16+/m0/s1
Standard InChI Key: DRNYEFOVJBNMRE-XJKSGUPXSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
12.7045 -7.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7045 -8.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4165 -9.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1286 -8.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1286 -7.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4165 -7.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8435 -9.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9286 -10.0546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7353 -10.2274 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1488 -9.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5976 -8.8996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9701 -9.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5214 -10.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2755 -9.7034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1904 -8.8827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3837 -8.7102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3487 -10.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9906 -9.2346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2755 -8.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5616 -9.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2743 -7.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9918 -10.0597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8491 -8.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1357 -9.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1365 -10.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8565 -10.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5670 -10.0597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8607 -11.2998 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 1 0
4 7 1 6
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
10 12 1 0
13 17 1 0
2 18 1 6
18 19 1 0
19 20 1 0
19 21 2 0
18 22 1 0
20 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 20 1 0
26 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.90Molecular Weight (Monoisotopic): 398.1622AlogP: 3.96#Rotatable Bonds: 4Polar Surface Area: 90.56Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.02CX Basic pKa: 5.46CX LogP: 2.10CX LogD: 2.07Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.70Np Likeness Score: -1.11
References 1. (2019) Cyclohexyl benzamide compounds,