The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3-((4-(2-chloroacetamido)-3,5-dimethyl-1H-pyrrol-2-yl)methylene)-2-oxo-N-(1-phenylethyl)indoline-5-carboxamide ID: ALA4791260
PubChem CID: 162672001
Max Phase: Preclinical
Molecular Formula: C26H25ClN4O3
Molecular Weight: 476.96
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c(/C=C2\C(=O)Nc3ccc(C(=O)N[C@H](C)c4ccccc4)cc32)c(C)c1NC(=O)CCl
Standard InChI: InChI=1S/C26H25ClN4O3/c1-14-22(28-16(3)24(14)31-23(32)13-27)12-20-19-11-18(9-10-21(19)30-26(20)34)25(33)29-15(2)17-7-5-4-6-8-17/h4-12,15,28H,13H2,1-3H3,(H,29,33)(H,30,34)(H,31,32)/b20-12-/t15-/m1/s1
Standard InChI Key: UWWMLSOJAKHPMN-GEYIUBJWSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
6.8457 -18.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8445 -19.3219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5526 -19.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5508 -18.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2594 -18.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2642 -19.3219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0486 -19.5717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5286 -18.9029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0408 -18.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3458 -18.8981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2887 -17.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0870 -17.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6987 -17.8283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4040 -17.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2294 -16.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4162 -16.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0036 -15.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1525 -17.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1378 -18.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1377 -17.2767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4302 -18.5027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7224 -18.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0148 -18.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7222 -17.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3055 -18.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5983 -18.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5981 -19.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3109 -19.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0151 -19.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7725 -16.0066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5729 -16.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1161 -15.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8300 -16.9474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9164 -15.7263 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
16 17 1 0
14 18 1 0
1 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
22 24 1 1
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
15 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.96Molecular Weight (Monoisotopic): 476.1615AlogP: 4.79#Rotatable Bonds: 6Polar Surface Area: 103.09Molecular Species: NEUTRALHBA: 3HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.92CX Basic pKa: ┄CX LogP: 3.97CX LogD: 3.97Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -0.90
References 1. Rowlands RA,Chen Q,Bouley RA,Avramova LV,Tesmer JJG,White AD. (2021) Generation of Highly Selective, Potent, and Covalent G Protein-Coupled Receptor Kinase 5 Inhibitors., 64 (1.0): [PMID:33393767 ] [10.1021/acs.jmedchem.0c01522 ] 2. Cho, Sung Yun SY and 9 more authors. 2013-12-15 Design and synthesis of novel 3-(benzo[d]oxazol-2-yl)-5-(1-(piperidin-4-yl)-1H-pyrazol-4-yl)pyridin-2-amine derivatives as selective G-protein-coupled receptor kinase-2 and -5 inhibitors. [PMID:24210504 ]