2-(4-chloro-3-methyl-phenyl)-5-nitro-1H-benzimidazole

ID: ALA4791269

PubChem CID: 162672211

Max Phase: Preclinical

Molecular Formula: C14H10ClN3O2

Molecular Weight: 287.71

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2nc3cc([N+](=O)[O-])ccc3[nH]2)ccc1Cl

Standard InChI:  InChI=1S/C14H10ClN3O2/c1-8-6-9(2-4-11(8)15)14-16-12-5-3-10(18(19)20)7-13(12)17-14/h2-7H,1H3,(H,16,17)

Standard InChI Key:  WFPICOYODRRXCO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
   29.6197  -28.9855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6186  -29.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3266  -30.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3248  -28.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0334  -28.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0337  -29.8051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8167  -30.0592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3004  -29.3931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8163  -28.7273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.1143  -29.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5226  -30.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3390  -30.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7482  -29.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3349  -28.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5199  -28.6858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9119  -28.5771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9117  -27.7599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2043  -28.9858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7408  -27.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5654  -29.3909    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
  1 16  1  0
 16 17  1  0
 16 18  2  0
 14 19  1  0
 13 20  1  0
M  CHG  2  16   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA4791269

    ---

Associated Targets(Human)

NPBWR1 Tchem Neuropeptides B/W receptor type 1 (709 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 287.71Molecular Weight (Monoisotopic): 287.0462AlogP: 4.10#Rotatable Bonds: 2
Polar Surface Area: 71.82Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.36CX Basic pKa: 3.28CX LogP: 4.34CX LogD: 4.34
Aromatic Rings: 3Heavy Atoms: 20QED Weighted: 0.57Np Likeness Score: -1.87

References

1. Moningka R,Romero FA,Hastings NB,Guo Z,Wang M,Di Salvo J,Li Y,Trusca D,Deng Q,Tong V,Terebetski JL,Ball RG,Ujjainwalla F.  (2020)  Fragment-based lead discovery of a novel class of small molecule antagonists of neuropeptide B/W receptor subtype 1 (GPR7).,  30  (23): [PMID:32898693] [10.1016/j.bmcl.2020.127510]

Source