(S)-5-(4-(3-methylmorpholino)-6-((4-(methylsulfonyl)piperazin-1-yl)methyl)pyrrolo[1,2-f][1,2,4]triazin-2-yl)-4-(trifluoromethyl)pyridin-2-amine

ID: ALA4791280

PubChem CID: 72550013

Max Phase: Preclinical

Molecular Formula: C23H29F3N8O3S

Molecular Weight: 554.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H]1COCCN1c1nc(-c2cnc(N)cc2C(F)(F)F)nn2cc(CN3CCN(S(C)(=O)=O)CC3)cc12

Standard InChI:  InChI=1S/C23H29F3N8O3S/c1-15-14-37-8-7-33(15)22-19-9-16(12-31-3-5-32(6-4-31)38(2,35)36)13-34(19)30-21(29-22)17-11-28-20(27)10-18(17)23(24,25)26/h9-11,13,15H,3-8,12,14H2,1-2H3,(H2,27,28)/t15-/m0/s1

Standard InChI Key:  AFUFOYSAHFAROX-HNNXBMFYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   18.0490  -23.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8639  -23.7479    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.4544  -23.0407    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.5059  -26.9818    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.7973  -26.5730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7942  -27.3902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9348  -24.9697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6400  -24.5653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6400  -23.7481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9348  -23.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2295  -24.5653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2295  -23.7435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4480  -23.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9649  -24.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4480  -24.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9339  -22.5148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6506  -22.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6516  -21.2889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9424  -20.8755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2304  -21.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2277  -22.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3453  -24.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3428  -25.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0491  -26.2017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7584  -25.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7569  -24.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0501  -24.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4644  -26.2060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1477  -24.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7391  -24.8621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9206  -24.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5121  -25.5655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9172  -26.2756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7353  -26.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1483  -25.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9118  -27.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3570  -22.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3408  -23.3419    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  2  0
  4  6  2  0
 12 10  1  0
 11  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 10 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  8 22  1  0
 25 28  1  0
 14 29  1  0
 29 30  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 33  4  1  0
  4 36  1  0
 27  1  1  0
 17 37  1  6
  1 38  1  0
M  END

Associated Targets(Human)

SJRH30 (203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3CA Tclin PI3-kinase p110-alpha subunit (12269 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 554.60Molecular Weight (Monoisotopic): 554.2035AlogP: 1.69#Rotatable Bonds: 5
Polar Surface Area: 122.19Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.71CX LogP: 2.42CX LogD: 2.41
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.50Np Likeness Score: -1.41

References

1. Xiang HY,Wang X,Chen YH,Zhang X,Tan C,Wang Y,Su Y,Gao ZW,Chen XY,Xiong B,Gao ZB,Chen Y,Ding J,Meng LH,Yang CH.  (2021)  Identification of methyl (5-(6-((4-(methylsulfonyl)piperazin-1-yl)methyl)-4-morpholinopyrrolo[2,1-f][1,2,4]triazin-2-yl)-4-(trifluoromethyl)pyridin-2-yl)carbamate (CYH33) as an orally bioavailable, highly potent, PI3K alpha inhibitor for the treatment of advanced solid tumors.,  209  [PMID:33109399] [10.1016/j.ejmech.2020.112913]

Source