The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-(4-(3-methylmorpholino)-6-((4-(methylsulfonyl)piperazin-1-yl)methyl)pyrrolo[1,2-f][1,2,4]triazin-2-yl)-4-(trifluoromethyl)pyridin-2-amine ID: ALA4791280
PubChem CID: 72550013
Max Phase: Preclinical
Molecular Formula: C23H29F3N8O3S
Molecular Weight: 554.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1COCCN1c1nc(-c2cnc(N)cc2C(F)(F)F)nn2cc(CN3CCN(S(C)(=O)=O)CC3)cc12
Standard InChI: InChI=1S/C23H29F3N8O3S/c1-15-14-37-8-7-33(15)22-19-9-16(12-31-3-5-32(6-4-31)38(2,35)36)13-34(19)30-21(29-22)17-11-28-20(27)10-18(17)23(24,25)26/h9-11,13,15H,3-8,12,14H2,1-2H3,(H2,27,28)/t15-/m0/s1
Standard InChI Key: AFUFOYSAHFAROX-HNNXBMFYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
18.0490 -23.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8639 -23.7479 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.4544 -23.0407 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.5059 -26.9818 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.7973 -26.5730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7942 -27.3902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9348 -24.9697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6400 -24.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6400 -23.7481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9348 -23.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2295 -24.5653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2295 -23.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4480 -23.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9649 -24.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4480 -24.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9339 -22.5148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6506 -22.1058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6516 -21.2889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9424 -20.8755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2304 -21.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2277 -22.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3453 -24.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3428 -25.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0491 -26.2017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7584 -25.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7569 -24.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0501 -24.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4644 -26.2060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1477 -24.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7391 -24.8621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9206 -24.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5121 -25.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9172 -26.2756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7353 -26.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1483 -25.5694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9118 -27.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3570 -22.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3408 -23.3419 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
5 4 2 0
4 6 2 0
12 10 1 0
11 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 11 1 0
10 16 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
8 22 1 0
25 28 1 0
14 29 1 0
29 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 4 1 0
4 36 1 0
27 1 1 0
17 37 1 6
1 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.60Molecular Weight (Monoisotopic): 554.2035AlogP: 1.69#Rotatable Bonds: 5Polar Surface Area: 122.19Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.71CX LogP: 2.42CX LogD: 2.41Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.50Np Likeness Score: -1.41
References 1. Xiang HY,Wang X,Chen YH,Zhang X,Tan C,Wang Y,Su Y,Gao ZW,Chen XY,Xiong B,Gao ZB,Chen Y,Ding J,Meng LH,Yang CH. (2021) Identification of methyl (5-(6-((4-(methylsulfonyl)piperazin-1-yl)methyl)-4-morpholinopyrrolo[2,1-f][1,2,4]triazin-2-yl)-4-(trifluoromethyl)pyridin-2-yl)carbamate (CYH33) as an orally bioavailable, highly potent, PI3K alpha inhibitor for the treatment of advanced solid tumors., 209 [PMID:33109399 ] [10.1016/j.ejmech.2020.112913 ]