The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tert-butyl-((S)-1-(((S)-1-(((S)-1-(furan-2-yl)-4-methyl-1-oxopentan-2-yl)amino)-3-methoxy-1-oxopropan-2-yl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)carbamate ID: ALA4791352
PubChem CID: 162671303
Max Phase: Preclinical
Molecular Formula: C29H41N3O8
Molecular Weight: 559.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC[C@H](NC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)OC(C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)c1ccco1
Standard InChI: InChI=1S/C29H41N3O8/c1-18(2)15-21(25(33)24-9-8-14-39-24)30-27(35)23(17-37-6)31-26(34)22(32-28(36)40-29(3,4)5)16-19-10-12-20(38-7)13-11-19/h8-14,18,21-23H,15-17H2,1-7H3,(H,30,35)(H,31,34)(H,32,36)/t21-,22-,23-/m0/s1
Standard InChI Key: IUDMKJHXTLYISA-VABKMULXSA-N
Molfile:
RDKit 2D
40 41 0 0 0 0 0 0 0 0999 V2000
27.9315 -18.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3461 -18.9002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7566 -18.1845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4814 -19.3191 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1967 -18.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9118 -19.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6270 -18.9086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3422 -19.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0573 -18.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7725 -19.3191 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4836 -18.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1987 -19.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9139 -18.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6672 -19.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2207 -18.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8061 -17.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9989 -18.0875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1987 -20.1442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4836 -18.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0573 -18.0833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9118 -20.1442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1967 -18.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3346 -20.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9118 -17.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6268 -18.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3415 -17.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3419 -16.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6217 -16.4355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9100 -16.8477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7715 -18.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0594 -19.3155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6373 -19.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7735 -18.0857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0519 -16.4335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6197 -20.5440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6121 -21.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0519 -15.6085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8961 -17.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4836 -16.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7211 -17.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
12 18 2 0
11 19 1 1
9 20 2 0
6 21 2 0
5 22 1 1
8 23 1 6
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
4 30 1 0
30 31 1 0
31 2 1 0
2 32 1 0
30 33 2 0
27 34 1 0
23 35 1 0
35 36 1 0
34 37 1 0
19 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 559.66Molecular Weight (Monoisotopic): 559.2894AlogP: 3.27#Rotatable Bonds: 14Polar Surface Area: 145.20Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.59CX Basic pKa: ┄CX LogP: 3.00CX LogD: 3.00Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: -0.37
References 1. Sun Q,Zhou T,Xi D,Li X,Lü Z,Xu F,Wang C,Niu Y,Xu P. (2020) Design and synthesis of tripeptidyl furylketones as selective inhibitors against the β5 subunit of human 20S proteasome., 192 [PMID:32146375 ] [10.1016/j.ejmech.2020.112160 ]