Tert-butyl-((S)-1-(((S)-1-(((S)-1-(furan-2-yl)-4-methyl-1-oxopentan-2-yl)amino)-3-methoxy-1-oxopropan-2-yl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)carbamate

ID: ALA4791352

PubChem CID: 162671303

Max Phase: Preclinical

Molecular Formula: C29H41N3O8

Molecular Weight: 559.66

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC[C@H](NC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)OC(C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)c1ccco1

Standard InChI:  InChI=1S/C29H41N3O8/c1-18(2)15-21(25(33)24-9-8-14-39-24)30-27(35)23(17-37-6)31-26(34)22(32-28(36)40-29(3,4)5)16-19-10-12-20(38-7)13-11-19/h8-14,18,21-23H,15-17H2,1-7H3,(H,30,35)(H,31,34)(H,32,36)/t21-,22-,23-/m0/s1

Standard InChI Key:  IUDMKJHXTLYISA-VABKMULXSA-N

Molfile:  

 
     RDKit          2D

 40 41  0  0  0  0  0  0  0  0999 V2000
   27.9315  -18.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3461  -18.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7566  -18.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4814  -19.3191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.1967  -18.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9118  -19.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6270  -18.9086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3422  -19.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0573  -18.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7725  -19.3191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4836  -18.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1987  -19.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9139  -18.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6672  -19.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2207  -18.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8061  -17.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9989  -18.0875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.1987  -20.1442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4836  -18.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0573  -18.0833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9118  -20.1442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1967  -18.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3346  -20.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9118  -17.6687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6268  -18.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3415  -17.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3419  -16.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6217  -16.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9100  -16.8477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7715  -18.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0594  -19.3155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6373  -19.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7735  -18.0857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.0519  -16.4335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6197  -20.5440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6121  -21.3649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0519  -15.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8961  -17.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4836  -16.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7211  -17.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  1  0
 12 18  2  0
 11 19  1  1
  9 20  2  0
  6 21  2  0
  5 22  1  1
  8 23  1  6
 22 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  4 30  1  0
 30 31  1  0
 31  2  1  0
  2 32  1  0
 30 33  2  0
 27 34  1  0
 23 35  1  0
 35 36  1  0
 34 37  1  0
 19 38  1  0
 38 39  1  0
 38 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4791352

    ---

Associated Targets(Human)

PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB1 Tclin Proteasome component C5 (935 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB2 Tclin Proteasome Macropain subunit (1025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 559.66Molecular Weight (Monoisotopic): 559.2894AlogP: 3.27#Rotatable Bonds: 14
Polar Surface Area: 145.20Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.59CX Basic pKa: CX LogP: 3.00CX LogD: 3.00
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: -0.37

References

1. Sun Q,Zhou T,Xi D,Li X,Lü Z,Xu F,Wang C,Niu Y,Xu P.  (2020)  Design and synthesis of tripeptidyl furylketones as selective inhibitors against the β5 subunit of human 20S proteasome.,  192  [PMID:32146375] [10.1016/j.ejmech.2020.112160]

Source