The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-methyl-7-(4-(1-(methylsulfonyl)-1H-pyrazol-4-yl)benzamido)-3,4-dihydroquinoline-1(2H)-carboxamide ID: ALA4791402
PubChem CID: 162671790
Max Phase: Preclinical
Molecular Formula: C22H23N5O4S
Molecular Weight: 453.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)N1CCCc2ccc(NC(=O)c3ccc(-c4cnn(S(C)(=O)=O)c4)cc3)cc21
Standard InChI: InChI=1S/C22H23N5O4S/c1-23-22(29)26-11-3-4-16-9-10-19(12-20(16)26)25-21(28)17-7-5-15(6-8-17)18-13-24-27(14-18)32(2,30)31/h5-10,12-14H,3-4,11H2,1-2H3,(H,23,29)(H,25,28)
Standard InChI Key: HWXIJBVITCOCSF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
11.2632 -10.0374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0527 -10.8298 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.8442 -10.6159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0073 -13.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7169 -13.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7141 -12.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0055 -12.2741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2992 -13.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3033 -12.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5995 -12.2718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8871 -12.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8830 -13.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5913 -13.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4203 -12.2681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1295 -12.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8357 -12.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1326 -13.4912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6048 -11.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3151 -11.0506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8997 -11.0416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1894 -11.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5433 -12.6721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2490 -12.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2464 -11.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5322 -11.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8294 -11.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9515 -11.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6998 -11.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2435 -10.7506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8312 -10.0449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0328 -10.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3928 -11.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
6 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
10 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
16 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 16 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 27 1 0
24 27 1 0
29 2 1 0
2 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.52Molecular Weight (Monoisotopic): 453.1471AlogP: 2.70#Rotatable Bonds: 4Polar Surface Area: 113.40Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.31CX LogD: 1.31Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: -1.58
References 1. Bi X,Chen Y,Sun Z,Lu W,Xu P,Lu T,Ding H,Zhang N,Jiang H,Chen K,Zhou B,Luo C. (2020) Structure-based drug optimization and biological evaluation of tetrahydroquinolin derivatives as selective and potent CBP bromodomain inhibitors., 30 (22): [PMID:32882416 ] [10.1016/j.bmcl.2020.127480 ]