N-methyl-7-(4-(1-(methylsulfonyl)-1H-pyrazol-4-yl)benzamido)-3,4-dihydroquinoline-1(2H)-carboxamide

ID: ALA4791402

PubChem CID: 162671790

Max Phase: Preclinical

Molecular Formula: C22H23N5O4S

Molecular Weight: 453.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)N1CCCc2ccc(NC(=O)c3ccc(-c4cnn(S(C)(=O)=O)c4)cc3)cc21

Standard InChI:  InChI=1S/C22H23N5O4S/c1-23-22(29)26-11-3-4-16-9-10-19(12-20(16)26)25-21(28)17-7-5-15(6-8-17)18-13-24-27(14-18)32(2,30)31/h5-10,12-14H,3-4,11H2,1-2H3,(H,23,29)(H,25,28)

Standard InChI Key:  HWXIJBVITCOCSF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   11.2632  -10.0374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0527  -10.8298    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.8442  -10.6159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0073  -13.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7169  -13.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7141  -12.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0055  -12.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2992  -13.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3033  -12.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5995  -12.2718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8871  -12.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8830  -13.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5913  -13.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4203  -12.2681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1295  -12.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8357  -12.2627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1326  -13.4912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6048  -11.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3151  -11.0506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8997  -11.0416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1894  -11.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5433  -12.6721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2490  -12.2615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2464  -11.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5322  -11.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8294  -11.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9515  -11.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6998  -11.3606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2435  -10.7506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8312  -10.0449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0328  -10.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3928  -11.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  8  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  6 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 10 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 16 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 16  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 27  1  0
 24 27  1  0
 29  2  1  0
  2 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4791402

    ---

Associated Targets(Human)

CREBBP Tchem CREB-binding protein (1602 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.52Molecular Weight (Monoisotopic): 453.1471AlogP: 2.70#Rotatable Bonds: 4
Polar Surface Area: 113.40Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.31CX LogD: 1.31
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: -1.58

References

1. Bi X,Chen Y,Sun Z,Lu W,Xu P,Lu T,Ding H,Zhang N,Jiang H,Chen K,Zhou B,Luo C.  (2020)  Structure-based drug optimization and biological evaluation of tetrahydroquinolin derivatives as selective and potent CBP bromodomain inhibitors.,  30  (22): [PMID:32882416] [10.1016/j.bmcl.2020.127480]

Source