2-((4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl)(methyl)amino)-3-hydroxy-N-(4-(trifluoromethyl)-benzyl)propanamide

ID: ALA4791461

PubChem CID: 162670413

Max Phase: Preclinical

Molecular Formula: C26H29F3N2O2S2

Molecular Weight: 522.66

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccsc1C(=CCCN(C)C(CO)C(=O)NCc1ccc(C(F)(F)F)cc1)c1sccc1C

Standard InChI:  InChI=1S/C26H29F3N2O2S2/c1-17-10-13-34-23(17)21(24-18(2)11-14-35-24)5-4-12-31(3)22(16-32)25(33)30-15-19-6-8-20(9-7-19)26(27,28)29/h5-11,13-14,22,32H,4,12,15-16H2,1-3H3,(H,30,33)

Standard InChI Key:  ZBIJKNQBLOSRQH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
    2.9041   -4.8459    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.7291   -4.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9859   -4.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3166   -3.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6516   -4.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2133   -5.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0339   -5.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8768   -6.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0709   -6.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9837   -7.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7370   -7.5902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2896   -6.9777    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.7710   -3.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4598   -5.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5181   -6.0966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3386   -6.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8228   -6.6794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6434   -6.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4863   -7.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1275   -7.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9798   -5.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8003   -5.7555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4957   -5.1728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7911   -8.0154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9596   -4.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1360   -5.0054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4381   -5.5968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2610   -5.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6027   -4.7605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1153   -4.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2941   -4.1712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4234   -4.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9056   -5.3472    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.7623   -3.9256    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.2459   -4.6751    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  2  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
  3 13  1  0
  9 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  2  0
 20 24  1  0
 22 26  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 29 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4791461

    ---

Associated Targets(non-human)

Slc6a11 GABA transporter 4 (930 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a13 GABA transporter 3 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a1 GABA transporter 1 (1980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 522.66Molecular Weight (Monoisotopic): 522.1623AlogP: 5.88#Rotatable Bonds: 10
Polar Surface Area: 52.57Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.59CX Basic pKa: 7.81CX LogP: 6.12CX LogD: 5.57
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -0.79

References

1. Zaręba P,Gryzło B,Malawska K,Sałat K,Höfner GC,Nowaczyk A,Fijałkowski Ł,Rapacz A,Podkowa A,Furgała A,Żmudzki P,Wanner KT,Malawska B,Kulig K.  (2020)  Novel mouse GABA uptake inhibitors with enhanced inhibitory activity toward mGAT3/4 and their effect on pain threshold in mice.,  188  [PMID:31901745] [10.1016/j.ejmech.2019.111920]

Source