The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-Amino-N-(2-hydroxyethyl)-3-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)propanamide ID: ALA4791487
PubChem CID: 162670818
Max Phase: Preclinical
Molecular Formula: C27H27F3N2O2S
Molecular Weight: 500.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21)C(=O)NCCO
Standard InChI: InChI=1S/C27H27F3N2O2S/c28-27(29,30)21-13-11-20(12-14-21)26(35-17-24(31)25(34)32-15-16-33)22-7-3-1-5-18(22)9-10-19-6-2-4-8-23(19)26/h1-8,11-14,24,33H,9-10,15-17,31H2,(H,32,34)
Standard InChI Key: NXZWOHUUEYVQES-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
23.3783 -5.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0811 -5.9288 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.1020 -5.1041 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.8075 -2.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3760 -3.3075 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.2007 -3.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4423 -0.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2631 -0.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0719 -2.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9127 -1.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1316 -1.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5092 -1.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6729 -2.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4538 -2.7712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7619 -1.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5601 -2.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1535 -2.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9490 -2.6158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1476 -1.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5527 -1.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5513 -3.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1199 -3.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2952 -3.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5131 -4.7139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9019 -3.2414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8637 -4.6698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7658 -4.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1584 -4.7561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9840 -4.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4154 -4.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0204 -3.3486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9477 -6.2071 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.0390 -4.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6077 -5.3509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7829 -5.3267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
5 4 1 0
4 6 1 0
7 8 1 0
8 15 1 0
7 10 1 0
16 4 1 0
9 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
5 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
23 25 2 0
23 26 1 0
6 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 6 1 0
29 1 1 0
1 32 1 0
26 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.59Molecular Weight (Monoisotopic): 500.1745AlogP: 4.26#Rotatable Bonds: 7Polar Surface Area: 75.35Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.04CX LogP: 4.87CX LogD: 4.15Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.45Np Likeness Score: -0.20
References 1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A. (2021) Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein., 215 [PMID:33640763 ] [10.1016/j.ejmech.2021.113288 ]