(R)-2-Amino-N-(2-hydroxyethyl)-3-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)propanamide

ID: ALA4791487

PubChem CID: 162670818

Max Phase: Preclinical

Molecular Formula: C27H27F3N2O2S

Molecular Weight: 500.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21)C(=O)NCCO

Standard InChI:  InChI=1S/C27H27F3N2O2S/c28-27(29,30)21-13-11-20(12-14-21)26(35-17-24(31)25(34)32-15-16-33)22-7-3-1-5-18(22)9-10-19-6-2-4-8-23(19)26/h1-8,11-14,24,33H,9-10,15-17,31H2,(H,32,34)

Standard InChI Key:  NXZWOHUUEYVQES-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   23.3783   -5.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0811   -5.9288    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.1020   -5.1041    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.8075   -2.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3760   -3.3075    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.2007   -3.3295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4423   -0.7861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2631   -0.8106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0719   -2.2285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9127   -1.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1316   -1.1505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5092   -1.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6729   -2.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4538   -2.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7619   -1.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5601   -2.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1535   -2.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9490   -2.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1476   -1.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5527   -1.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5513   -3.2855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1199   -3.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2952   -3.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5131   -4.7139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9019   -3.2414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8637   -4.6698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7658   -4.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1584   -4.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9840   -4.7786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4154   -4.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0204   -3.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9477   -6.2071    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.0390   -4.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6077   -5.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7829   -5.3267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  1  0
  4  6  1  0
  7  8  1  0
  8 15  1  0
  7 10  1  0
 16  4  1  0
  9  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 23 25  2  0
 23 26  1  0
  6 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31  6  1  0
 29  1  1  0
  1 32  1  0
 26 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4791487

    ---

Associated Targets(Human)

KIF11 Tchem Kinesin-like protein 1 (1720 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.59Molecular Weight (Monoisotopic): 500.1745AlogP: 4.26#Rotatable Bonds: 7
Polar Surface Area: 75.35Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.04CX LogP: 4.87CX LogD: 4.15
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.45Np Likeness Score: -0.20

References

1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A.  (2021)  Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein.,  215  [PMID:33640763] [10.1016/j.ejmech.2021.113288]

Source