N-((R)-Carbamoylphenylmethyl)-N-[(R)-1-(3,5-difluorophenyl)ethyl]-2-hydroxybenzamide

ID: ALA4791592

PubChem CID: 118247008

Max Phase: Preclinical

Molecular Formula: C23H20F2N2O3

Molecular Weight: 410.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](c1cc(F)cc(F)c1)N(C(=O)c1ccccc1O)[C@@H](C(N)=O)c1ccccc1

Standard InChI:  InChI=1S/C23H20F2N2O3/c1-14(16-11-17(24)13-18(25)12-16)27(23(30)19-9-5-6-10-20(19)28)21(22(26)29)15-7-3-2-4-8-15/h2-14,21,28H,1H3,(H2,26,29)/t14-,21-/m1/s1

Standard InChI Key:  RJQVGHLPISEKIW-SPLOXXLWSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    5.6281   -1.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6270   -2.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3391   -2.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0529   -2.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0501   -1.3501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3374   -0.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3389   -3.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6270   -3.8202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0507   -3.8205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7626   -3.4121    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0505   -4.6419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9153   -3.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2033   -3.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4948   -3.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7875   -3.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7869   -4.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4995   -5.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2080   -4.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9155   -2.5901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6268   -4.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9149   -5.0541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2074   -5.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9944   -6.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5700   -6.5872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3615   -6.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5701   -5.5802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9930   -5.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0801   -3.4063    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.5011   -5.8675    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.2050   -6.2235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  3  1  6
  7  8  1  0
  7  9  1  0
  9 10  1  0
  9 11  2  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 12 19  1  1
  8 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 15 28  1  0
 17 29  1  0
 23 30  1  0
M  END

Associated Targets(Human)

TRPM8 Tclin Transient receptor potential cation channel subfamily M member 8 (1168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.42Molecular Weight (Monoisotopic): 410.1442AlogP: 4.10#Rotatable Bonds: 6
Polar Surface Area: 83.63Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.16CX Basic pKa: CX LogP: 4.65CX LogD: 4.58
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: -0.88

References

1. Kobayashi JI,Hirasawa H,Fujimori Y,Nakanishi O,Kamada N,Ikeda T,Yamamoto A,Kanbe H.  (2021)  Identification of N-acyl-N-indanyl-α-phenylglycinamides as selective TRPM8 antagonists designed to mitigate the risk of adverse effects.,  30  [PMID:33333445] [10.1016/j.bmc.2020.115903]

Source