N-(4-hydroxyphenyl)-2-[[2-(morpholine-4-carbonyl)phenyl]sulfonylamino]acetamide

ID: ALA4791601

PubChem CID: 146660785

Max Phase: Preclinical

Molecular Formula: C19H21N3O6S

Molecular Weight: 419.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CNS(=O)(=O)c1ccccc1C(=O)N1CCOCC1)Nc1ccc(O)cc1

Standard InChI:  InChI=1S/C19H21N3O6S/c23-15-7-5-14(6-8-15)21-18(24)13-20-29(26,27)17-4-2-1-3-16(17)19(25)22-9-11-28-12-10-22/h1-8,20,23H,9-13H2,(H,21,24)

Standard InChI Key:  OHQUGGLLIHIBJO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   20.1908  -15.1619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6619  -14.4846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8384  -14.4142    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.6982  -14.8331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6971  -15.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4119  -16.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1284  -15.6600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1255  -14.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4102  -14.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4077  -13.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1209  -13.1807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6920  -13.1850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8353  -13.5893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5482  -13.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2642  -13.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2674  -14.4089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9771  -13.1687    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6931  -13.5785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6916  -14.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4068  -14.8106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1207  -14.3953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1149  -13.5661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3992  -13.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8372  -14.8042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6922  -12.3565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9806  -11.9462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2649  -12.3573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2654  -13.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9816  -13.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  1  3  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8  3  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 12 25  1  0
 12 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4791601

    ---

Associated Targets(Human)

Hepatocyte (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.46Molecular Weight (Monoisotopic): 419.1151AlogP: 0.78#Rotatable Bonds: 6
Polar Surface Area: 125.04Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 0.49CX LogD: 0.48
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -1.79

References

1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG.  (2020)  A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis.,  202  [PMID:32629335] [10.1016/j.ejmech.2020.112600]

Source