(Pivaloyloxy)methyl (R)-4-(6-chloro-4((5-cyclopropyl-1H-pyrazol-3-yl)amino)quinazoline-2-carbonyl)-2-methylpiperazine-1-carboxylate

ID: ALA4791673

PubChem CID: 162670428

Max Phase: Preclinical

Molecular Formula: C27H32ClN7O5

Molecular Weight: 570.05

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1CN(C(=O)c2nc(Nc3cc(C4CC4)[nH]n3)c3cc(Cl)ccc3n2)CCN1C(=O)OCOC(=O)C(C)(C)C

Standard InChI:  InChI=1S/C27H32ClN7O5/c1-15-13-34(9-10-35(15)26(38)40-14-39-25(37)27(2,3)4)24(36)23-29-19-8-7-17(28)11-18(19)22(31-23)30-21-12-20(32-33-21)16-5-6-16/h7-8,11-12,15-16H,5-6,9-10,13-14H2,1-4H3,(H2,29,30,31,32,33)/t15-/m1/s1

Standard InChI Key:  SQUBKROAZHFIRK-OAHLLOKOSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   35.8023  -11.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8011  -12.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5092  -12.6898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5074  -11.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2160  -11.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2168  -12.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9253  -12.6838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.6336  -12.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6288  -11.4508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9197  -11.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0945  -11.0528    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   37.9154  -10.2303    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.6209   -9.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3664  -10.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9100   -9.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4976   -8.8302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.6992   -9.0045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.7200   -9.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3836  -10.0908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4647   -9.2777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3429  -12.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3460  -13.4960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0490  -12.2674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.7555  -12.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4595  -12.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4606  -11.4517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.7514  -11.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0413  -11.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1673  -12.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1704  -11.0402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8781  -11.4487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1703  -10.2230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.5858  -11.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2935  -11.4486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.0012  -11.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7089  -11.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0011  -10.2227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.7090  -12.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4166  -11.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4107  -11.8534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 13  2  0
 19 18  1  0
 20 19  1  0
 18 20  1  0
 15 18  1  0
  8 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 25 29  1  6
 30 31  1  0
 30 32  2  0
 26 30  1  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  2  0
 36 38  1  0
 36 39  1  0
 36 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4791673

    ---

Associated Targets(Human)

PAK4 Tchem Serine/threonine-protein kinase PAK 4 (3212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 570.05Molecular Weight (Monoisotopic): 569.2153AlogP: 4.46#Rotatable Bonds: 6
Polar Surface Area: 142.64Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.18CX Basic pKa: 2.97CX LogP: 5.27CX LogD: 5.27
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: -1.16

References

1. Guo J,Wang T,Wu T,Zhang K,Yin W,Zhu M,Pang Y,Hao C,He Z,Cheng M,Liu Y,Zheng J,Gu J,Zhao D.  (2020)  Synthesis, bioconversion, pharmacokinetic and pharmacodynamic evaluation of N-isopropyl-oxy-carbonyloxymethyl prodrugs of CZh-226, a potent and selective PAK4 inhibitor.,  186  [PMID:31757524] [10.1016/j.ejmech.2019.111878]

Source