The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(10,11-Dihydro-5H-dibenzo[b,f]azepin-5-yl)(4-(3-(dimethylamino)propoxy)phenyl)methanone ID: ALA4791782
PubChem CID: 162672250
Max Phase: Preclinical
Molecular Formula: C26H28N2O2
Molecular Weight: 400.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCOc1ccc(C(=O)N2c3ccccc3CCc3ccccc32)cc1
Standard InChI: InChI=1S/C26H28N2O2/c1-27(2)18-7-19-30-23-16-14-22(15-17-23)26(29)28-24-10-5-3-8-20(24)12-13-21-9-4-6-11-25(21)28/h3-6,8-11,14-17H,7,12-13,18-19H2,1-2H3
Standard InChI Key: NCEJIQKGPVAIRP-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
5.7643 -4.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7632 -4.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4712 -5.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1809 -4.9669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1781 -4.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4694 -3.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8892 -5.3744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5963 -4.9647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3046 -5.3722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0117 -4.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7201 -5.3699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0565 -3.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3489 -4.1482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0563 -2.9222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7213 -6.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4271 -4.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6450 -1.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4611 -1.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9745 -1.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7915 -2.5647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3927 -3.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1771 -2.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3569 -2.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7543 -1.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3245 -2.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1402 -1.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3599 -1.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7632 -2.0885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9521 -2.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7321 -3.1204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
1 12 1 0
12 13 2 0
12 14 1 0
11 15 1 0
11 16 1 0
14 25 1 0
14 20 1 0
26 17 1 0
17 18 1 0
19 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.52Molecular Weight (Monoisotopic): 400.2151AlogP: 5.09#Rotatable Bonds: 6Polar Surface Area: 32.78Molecular Species: BASEHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.26CX LogP: 5.07CX LogD: 3.22Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: -0.80
References 1. Cardoso FC,Marliac MA,Geoffroy C,Schmit M,Bispat A,Lewis RJ,Tuck KL,Duggan PJ. (2020) The neuronal calcium ion channel activity of constrained analogues of MONIRO-1., 28 (18): [PMID:32828422 ] [10.1016/j.bmc.2020.115655 ]