The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((2,4-difluorobenzylamino)(1-hydroxy-2-oxopiperidin-3-yl)phosphoryloxy)methyl pivalate ID: ALA4791988
PubChem CID: 155013159
Max Phase: Preclinical
Molecular Formula: C18H25F2N2O6P
Molecular Weight: 434.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)C(=O)OCOP(=O)(NCc1ccc(F)cc1F)C1CCCN(O)C1=O
Standard InChI: InChI=1S/C18H25F2N2O6P/c1-18(2,3)17(24)27-11-28-29(26,15-5-4-8-22(25)16(15)23)21-10-12-6-7-13(19)9-14(12)20/h6-7,9,15,25H,4-5,8,10-11H2,1-3H3,(H,21,26)
Standard InChI Key: LMBDVKQVIFTLRS-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
5.4126 -24.6377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8292 -25.3543 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
6.2415 -24.6351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -27.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6897 -26.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6897 -25.7710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -25.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -24.5335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1187 -25.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1187 -26.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9753 -25.3585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5476 -25.7710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5460 -26.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2597 -27.0099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2580 -27.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9717 -28.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5428 -28.2460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9701 -29.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6870 -27.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6833 -28.6585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0665 -24.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4768 -23.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3070 -23.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7173 -23.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3025 -22.4937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4733 -22.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0667 -23.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7195 -24.6335 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.7120 -21.7775 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 10 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
6 11 1 0
9 2 1 0
2 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
16 19 1 0
16 20 1 0
3 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
23 28 1 0
25 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.38Molecular Weight (Monoisotopic): 434.1418AlogP: 3.19#Rotatable Bonds: 7Polar Surface Area: 105.17Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.28CX Basic pKa: ┄CX LogP: 2.49CX LogD: 2.43Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.29Np Likeness Score: -0.31
References 1. Yan VC,Pham CD,Arthur K,Yang KL,Muller FL. (2020) Aliphatic amines are viable pro-drug moieties in phosphonoamidate drugs., 30 (24): [PMID:33130289 ] [10.1016/j.bmcl.2020.127656 ] 2. Yan VC, Pham CD, Ballato ES, Yang KL, Arthur K, Khadka S, Barekatain Y, Shrestha P, Tran T, Poral AH, Washington M, Raghavan S, Czako B, Pisaneschi F, Lin YH, Satani N, Hammoudi N, Ackroyd JJ, Georgiou DK, Millward SW, Muller FL.. (2022) Prodrugs of a 1-Hydroxy-2-oxopiperidin-3-yl Phosphonate Enolase Inhibitor for the Treatment of ENO1 -Deleted Cancers., 65 (20.0): [PMID:36251833 ] [10.1021/acs.jmedchem.2c01039 ]