((2,4-difluorobenzylamino)(1-hydroxy-2-oxopiperidin-3-yl)phosphoryloxy)methyl pivalate

ID: ALA4791988

PubChem CID: 155013159

Max Phase: Preclinical

Molecular Formula: C18H25F2N2O6P

Molecular Weight: 434.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)C(=O)OCOP(=O)(NCc1ccc(F)cc1F)C1CCCN(O)C1=O

Standard InChI:  InChI=1S/C18H25F2N2O6P/c1-18(2,3)17(24)27-11-28-29(26,15-5-4-8-22(25)16(15)23)21-10-12-6-7-13(19)9-14(12)20/h6-7,9,15,25H,4-5,8,10-11H2,1-3H3,(H,21,26)

Standard InChI Key:  LMBDVKQVIFTLRS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 30  0  0  0  0  0  0  0  0999 V2000
    5.4126  -24.6377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8292  -25.3543    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    6.2415  -24.6351    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4042  -27.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6897  -26.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6897  -25.7710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4042  -25.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4042  -24.5335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1187  -25.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1187  -26.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9753  -25.3585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5476  -25.7710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5460  -26.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2597  -27.0099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2580  -27.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9717  -28.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5428  -28.2460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9701  -29.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6870  -27.8378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6833  -28.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0665  -24.6326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4768  -23.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3070  -23.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7173  -23.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3025  -22.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4733  -22.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0667  -23.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7195  -24.6335    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7120  -21.7775    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4 10  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
  6 11  1  0
  9  2  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 16 19  1  0
 16 20  1  0
  3 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 23 28  1  0
 25 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4791988

    ---

Associated Targets(Human)

D-423MG (162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.38Molecular Weight (Monoisotopic): 434.1418AlogP: 3.19#Rotatable Bonds: 7
Polar Surface Area: 105.17Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.28CX Basic pKa: CX LogP: 2.49CX LogD: 2.43
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.29Np Likeness Score: -0.31

References

1. Yan VC,Pham CD,Arthur K,Yang KL,Muller FL.  (2020)  Aliphatic amines are viable pro-drug moieties in phosphonoamidate drugs.,  30  (24): [PMID:33130289] [10.1016/j.bmcl.2020.127656]
2. Yan VC, Pham CD, Ballato ES, Yang KL, Arthur K, Khadka S, Barekatain Y, Shrestha P, Tran T, Poral AH, Washington M, Raghavan S, Czako B, Pisaneschi F, Lin YH, Satani N, Hammoudi N, Ackroyd JJ, Georgiou DK, Millward SW, Muller FL..  (2022)  Prodrugs of a 1-Hydroxy-2-oxopiperidin-3-yl Phosphonate Enolase Inhibitor for the Treatment of ENO1-Deleted Cancers.,  65  (20.0): [PMID:36251833] [10.1021/acs.jmedchem.2c01039]

Source