The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(8-isopropyl-5-methyl-2-(5-(piperazin-1-ylmethyl)pyridin-2-yl)amino)imidazo[1',2':1,6]pyrido[2,3-d]pyrimidin-6-yl)ethan-1-one ID: ALA4792101
PubChem CID: 162671814
Max Phase: Preclinical
Molecular Formula: C25H30N8O
Molecular Weight: 458.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1c(C)c2cnc(Nc3ccc(CN4CCNCC4)cn3)nc2n2cc(C(C)C)nc12
Standard InChI: InChI=1S/C25H30N8O/c1-15(2)20-14-33-23-19(16(3)22(17(4)34)24(33)29-20)12-28-25(31-23)30-21-6-5-18(11-27-21)13-32-9-7-26-8-10-32/h5-6,11-12,14-15,26H,7-10,13H2,1-4H3,(H,27,28,30,31)
Standard InChI Key: KSHZWPCJWQWIST-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
35.4116 -12.8947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4105 -13.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1260 -14.1372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1242 -12.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8360 -12.8911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8368 -13.7181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2637 -12.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5471 -12.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2684 -13.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5511 -14.1278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7242 -14.9367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5459 -15.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8822 -14.2702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5428 -11.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6950 -14.1363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.9738 -12.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9547 -15.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6923 -12.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9669 -11.6436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5424 -16.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7797 -15.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9802 -13.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9855 -12.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2715 -12.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5551 -12.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5571 -13.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2716 -14.1359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8397 -12.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1248 -12.8959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4166 -12.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7038 -12.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7000 -13.7140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4152 -14.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1301 -13.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 2 0
8 14 1 0
2 15 1 0
7 16 1 0
12 17 1 0
16 18 1 0
16 19 2 0
17 20 1 0
17 21 1 0
15 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.57Molecular Weight (Monoisotopic): 458.2543AlogP: 3.46#Rotatable Bonds: 6Polar Surface Area: 100.34Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.69CX Basic pKa: 9.04CX LogP: 2.04CX LogD: 0.76Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.06
References 1. Shi C,Wang Q,Liao X,Ge H,Huo G,Zhang L,Chen N,Zhai X,Hong Y,Wang L,Wang Z,Shi W,Mao Y,Yu J,Ke Y,Xia G. (2020) Discovery of a novel series of imidazo[1',2':1,6]pyrido[2,3-d]pyrimidin derivatives as potent cyclin-dependent kinase 4/6 inhibitors., 193 [PMID:32200202 ] [10.1016/j.ejmech.2020.112239 ]