The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Phenyl-13alpha,12alpha-dihydroxy-5beta-cholan-24-amide ID: ALA4792214
PubChem CID: 142772720
Max Phase: Preclinical
Molecular Formula: C30H45NO3
Molecular Weight: 467.69
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](CCC(=O)Nc1ccccc1)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C
Standard InChI: InChI=1S/C30H45NO3/c1-19(9-14-28(34)31-21-7-5-4-6-8-21)24-12-13-25-23-11-10-20-17-22(32)15-16-29(20,2)26(23)18-27(33)30(24,25)3/h4-8,19-20,22-27,32-33H,9-18H2,1-3H3,(H,31,34)/t19-,20-,22-,23+,24-,25+,26+,27+,29+,30-/m1/s1
Standard InChI Key: ABTFODLFVYTBHS-YAIFJCAJSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
26.3697 -8.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3697 -9.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0828 -9.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0828 -8.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7918 -8.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7928 -9.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5049 -9.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2206 -9.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5029 -8.3235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2191 -8.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2271 -7.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5037 -7.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9434 -7.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9353 -8.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7181 -8.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2116 -7.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7312 -7.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9927 -6.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8020 -6.3094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0676 -5.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8769 -5.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1384 -4.5880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.4197 -5.9844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4490 -5.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9377 -6.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7844 -7.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7886 -10.3845 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.5557 -7.2562 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
29.9293 -9.1523 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
29.2116 -7.9159 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.4980 -9.1439 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
33.9438 -4.4261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4811 -5.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2858 -4.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5489 -4.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0012 -3.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1985 -3.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2326 -6.2631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6585 -9.9740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 12 1 0
10 14 1 0
13 11 1 0
11 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
18 24 1 6
13 25 1 1
5 26 1 1
6 27 1 1
17 28 1 6
14 29 1 6
10 30 1 1
9 31 1 6
22 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
11 38 1 6
2 39 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.69Molecular Weight (Monoisotopic): 467.3399AlogP: 6.03#Rotatable Bonds: 5Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.23CX LogD: 5.23Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: 1.67
References 1. Vasiljevic, Bojana R., Petri, Edward T., Bekic, Sofija S., Celic, Andjelka S., Grbovic, Ljubica M., Pavlovic, Ksenija J.. (2021) Microwave-assisted green synthesis of bile acid derivatives and evaluation of glucocorticoid receptor binding, 12 (2): [PMID:34046616 ] [10.1039/d0md00311e ] 2. Sharma SK, Yip C, Simon MP, Phan J, Abel-Santos E, Firestine SM.. (2021) Studies on the Importance of the 7α-, and 12α- hydroxyl groups of N-Aryl-3α,7α,12α-trihydroxy-5β-cholan-24-amides on their Antigermination Activity Against a Hypervirulent Strain of Clostridioides (Clostridium) difficile., 52 [PMID:34837818 ] [10.1016/j.bmc.2021.116503 ]