N-Phenyl-13alpha,12alpha-dihydroxy-5beta-cholan-24-amide

ID: ALA4792214

PubChem CID: 142772720

Max Phase: Preclinical

Molecular Formula: C30H45NO3

Molecular Weight: 467.69

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  C[C@H](CCC(=O)Nc1ccccc1)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C

Standard InChI:  InChI=1S/C30H45NO3/c1-19(9-14-28(34)31-21-7-5-4-6-8-21)24-12-13-25-23-11-10-20-17-22(32)15-16-29(20,2)26(23)18-27(33)30(24,25)3/h4-8,19-20,22-27,32-33H,9-18H2,1-3H3,(H,31,34)/t19-,20-,22-,23+,24-,25+,26+,27+,29+,30-/m1/s1

Standard InChI Key:  ABTFODLFVYTBHS-YAIFJCAJSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   26.3697   -8.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3697   -9.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0828   -9.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0828   -8.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7918   -8.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7928   -9.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5049   -9.9746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2206   -9.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5029   -8.3235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2191   -8.7401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2271   -7.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5037   -7.4965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9434   -7.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9353   -8.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7181   -8.5925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2116   -7.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7312   -7.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9927   -6.4765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8020   -6.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0676   -5.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8769   -5.3637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1384   -4.5880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4197   -5.9844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4490   -5.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9377   -6.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7844   -7.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7886  -10.3845    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.5557   -7.2562    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.9293   -9.1523    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.2116   -7.9159    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.4980   -9.1439    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.9438   -4.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4811   -5.0443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2858   -4.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5489   -4.1037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0012   -3.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1985   -3.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2326   -6.2631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6585   -9.9740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 18 24  1  6
 13 25  1  1
  5 26  1  1
  6 27  1  1
 17 28  1  6
 14 29  1  6
 10 30  1  1
  9 31  1  6
 22 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 11 38  1  6
  2 39  1  6
M  END

Alternative Forms

1. Parent:

   

   ALA4792214

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 467.69

Molecular Weight (Monoisotopic): 467.3399

AlogP: 6.03

#Rotatable Bonds: 5

Polar Surface Area: 69.56

Molecular Species: NEUTRAL

HBA: 3

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 4

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 5.23

CX LogD: 5.23

Aromatic Rings: 1

Heavy Atoms: 34

QED Weighted: 0.49

Np Likeness Score: 1.67

References

1. Vasiljevic, Bojana R., Petri, Edward T., Bekic, Sofija S., Celic, Andjelka S., Grbovic, Ljubica M., Pavlovic, Ksenija J..  (2021)  Microwave-assisted green synthesis of bile acid derivatives and evaluation of glucocorticoid receptor binding,  12  (2): [PMID:34046616] [10.1039/d0md00311e]

2. Sharma SK, Yip C, Simon MP, Phan J, Abel-Santos E, Firestine SM..  (2021)  Studies on the Importance of the 7α-, and 12α- hydroxyl groups of N-Aryl-3α,7α,12α-trihydroxy-5β-cholan-24-amides on their Antigermination Activity Against a Hypervirulent Strain of Clostridioides (Clostridium) difficile.,  52  [PMID:34837818] [10.1016/j.bmc.2021.116503]

Source

Source(1):

• Scientific Literature