The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-N-(2-(Diethylamino)ethyl)-2,4-dimethyl-5-((2-oxo-5-(ureidomethyl)indolin-3-ylidene)methyl)-1H-pyrrole-3-carboxamide ID: ALA4792246
PubChem CID: 162671464
Max Phase: Preclinical
Molecular Formula: C24H32N6O3
Molecular Weight: 452.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(CNC(N)=O)cc32)c1C
Standard InChI: InChI=1S/C24H32N6O3/c1-5-30(6-2)10-9-26-23(32)21-14(3)20(28-15(21)4)12-18-17-11-16(13-27-24(25)33)7-8-19(17)29-22(18)31/h7-8,11-12,28H,5-6,9-10,13H2,1-4H3,(H,26,32)(H,29,31)(H3,25,27,33)/b18-12-
Standard InChI Key: ZSSGLTYUJFFIAZ-PDGQHHTCSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
13.5691 -29.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5679 -30.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2828 -31.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2810 -29.4991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9963 -29.9081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9966 -30.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7870 -30.9958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2753 -30.3232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7866 -29.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0413 -28.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1003 -30.3230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8488 -28.6963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4004 -29.3077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1523 -28.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0655 -28.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2599 -27.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9235 -27.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6780 -27.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4628 -27.8545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5055 -26.7936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8672 -29.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0754 -27.3019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8602 -27.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4727 -27.0034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2576 -27.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8701 -26.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3003 -26.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9128 -25.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8512 -29.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8508 -28.6727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5651 -28.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5647 -27.4350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2797 -28.6721 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
10 12 1 0
8 11 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
16 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
14 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
1 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.56Molecular Weight (Monoisotopic): 452.2536AlogP: 2.36#Rotatable Bonds: 9Polar Surface Area: 132.35Molecular Species: BASEHBA: 4HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.28CX Basic pKa: 9.04CX LogP: 1.40CX LogD: -0.25Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -1.02
References 1. Matheson CJ,Casalvieri KA,Backos DS,Minhajuddin M,Jordan CT,Reigan P. (2020) Substituted oxindol-3-ylidenes as AMP-activated protein kinase (AMPK) inhibitors., 197 [PMID:32334266 ] [10.1016/j.ejmech.2020.112316 ]