Tert-butyl (R)-4-(6-chloro-4((5-cyclopropyl-1H-pyrazol-3-yl)amino)quinazoline-2-carbony1)-2-methyl piperazine-1-carboxylate

ID: ALA4792396

PubChem CID: 153529970

Max Phase: Preclinical

Molecular Formula: C25H30ClN7O3

Molecular Weight: 512.01

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1CN(C(=O)c2nc(Nc3cc(C4CC4)[nH]n3)c3cc(Cl)ccc3n2)CCN1C(=O)OC(C)(C)C

Standard InChI:  InChI=1S/C25H30ClN7O3/c1-14-13-32(9-10-33(14)24(35)36-25(2,3)4)23(34)22-27-18-8-7-16(26)11-17(18)21(29-22)28-20-12-19(30-31-20)15-5-6-15/h7-8,11-12,14-15H,5-6,9-10,13H2,1-4H3,(H2,27,28,29,30,31)/t14-/m1/s1

Standard InChI Key:  RRNJKIRZKYZEQU-CQSZACIVSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   13.9775   -4.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9764   -5.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6844   -5.6611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6826   -4.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3912   -4.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3920   -5.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1005   -5.6551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8088   -5.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8041   -4.4221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0950   -4.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2697   -4.0242    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.0906   -3.2016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7961   -2.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5416   -3.1173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0852   -2.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6728   -1.8016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8744   -1.9758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8952   -2.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5588   -3.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6399   -2.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5181   -5.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5213   -6.4673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2242   -5.2388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9307   -5.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6348   -5.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6358   -4.4230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9267   -4.0150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2165   -4.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3425   -5.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3456   -4.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0533   -4.4201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3455   -3.1944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7610   -4.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4687   -4.4199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7609   -3.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4645   -3.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 13  2  0
 19 18  1  0
 20 19  1  0
 18 20  1  0
 15 18  1  0
  8 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 25 29  1  6
 30 31  1  0
 30 32  2  0
 26 30  1  0
 31 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4792396

    ---

Associated Targets(Human)

PAK4 Tchem Serine/threonine-protein kinase PAK 4 (3212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.01Molecular Weight (Monoisotopic): 511.2099AlogP: 4.71#Rotatable Bonds: 4
Polar Surface Area: 116.34Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.18CX Basic pKa: 2.97CX LogP: 4.44CX LogD: 4.44
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.52Np Likeness Score: -1.50

References

1. Guo J,Wang T,Wu T,Zhang K,Yin W,Zhu M,Pang Y,Hao C,He Z,Cheng M,Liu Y,Zheng J,Gu J,Zhao D.  (2020)  Synthesis, bioconversion, pharmacokinetic and pharmacodynamic evaluation of N-isopropyl-oxy-carbonyloxymethyl prodrugs of CZh-226, a potent and selective PAK4 inhibitor.,  186  [PMID:31757524] [10.1016/j.ejmech.2019.111878]

Source