4-Amino-N-benzyl-2-((4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl)(methyl)amino)butanamide

ID: ALA4792403

PubChem CID: 162671706

Max Phase: Preclinical

Molecular Formula: C26H33N3OS2

Molecular Weight: 467.70

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccsc1C(=CCCN(C)C(CCN)C(=O)NCc1ccccc1)c1sccc1C

Standard InChI:  InChI=1S/C26H33N3OS2/c1-19-12-16-31-24(19)22(25-20(2)13-17-32-25)10-7-15-29(3)23(11-14-27)26(30)28-18-21-8-5-4-6-9-21/h4-6,8-10,12-13,16-17,23H,7,11,14-15,18,27H2,1-3H3,(H,28,30)

Standard InChI Key:  KFCRYPYOVFYCOT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    3.0998   -3.7498    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.9248   -3.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1816   -2.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5123   -2.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8473   -2.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4089   -4.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2295   -4.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0725   -5.1711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2666   -5.3373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1793   -6.1576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9326   -6.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4852   -5.8816    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.9665   -2.7119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6555   -4.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7136   -5.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5341   -4.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0182   -5.5832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8387   -5.4980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6818   -6.3365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3229   -6.1659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1752   -4.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9957   -4.6594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6910   -4.0767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9865   -6.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4706   -7.5872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1549   -3.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3314   -3.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6335   -4.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4563   -4.4192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7979   -3.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3105   -2.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4894   -3.0752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  2  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
  3 13  1  0
  9 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  2  0
 20 24  1  0
 24 25  1  0
 22 27  1  0
 26 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4792403

    ---

Associated Targets(non-human)

Slc6a11 GABA transporter 4 (930 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a13 GABA transporter 3 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a1 GABA transporter 1 (1980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.70Molecular Weight (Monoisotopic): 467.2065AlogP: 5.21#Rotatable Bonds: 11
Polar Surface Area: 58.36Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.66CX LogP: 5.19CX LogD: 2.83
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -0.55

References

1. Zaręba P,Gryzło B,Malawska K,Sałat K,Höfner GC,Nowaczyk A,Fijałkowski Ł,Rapacz A,Podkowa A,Furgała A,Żmudzki P,Wanner KT,Malawska B,Kulig K.  (2020)  Novel mouse GABA uptake inhibitors with enhanced inhibitory activity toward mGAT3/4 and their effect on pain threshold in mice.,  188  [PMID:31901745] [10.1016/j.ejmech.2019.111920]

Source