The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Rhamnoneuroside B ID: ALA4792419
PubChem CID: 162671828
Max Phase: Preclinical
Molecular Formula: C35H32O15
Molecular Weight: 692.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2c(cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c2O[C@H](c2ccc(O)cc2)[C@H]3c2cc(O)cc(O)c2)O[C@@H](c2ccc(O)c(O)c2)[C@@H]1O
Standard InChI: InChI=1S/C35H32O15/c36-12-23-27(42)29(44)31(46)35(49-23)48-21-11-22-26(28(43)30(45)33(47-22)14-3-6-19(40)20(41)9-14)34-25(21)24(15-7-17(38)10-18(39)8-15)32(50-34)13-1-4-16(37)5-2-13/h1-11,23-24,27,29-33,35-42,44-46H,12H2/t23-,24+,27-,29+,30-,31-,32-,33+,35-/m1/s1
Standard InChI Key: KWRFGDXQINVWGK-SIQQMFMDSA-N
Molfile:
RDKit 2D
50 56 0 0 0 0 0 0 0 0999 V2000
17.6761 -16.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4075 -15.6878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4415 -14.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7454 -14.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0136 -14.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9778 -15.6334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1729 -14.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2081 -13.6609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7806 -13.5989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3171 -14.3640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2484 -16.0192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6441 -16.8902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3626 -17.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0746 -16.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7878 -17.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7860 -18.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4996 -18.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2178 -18.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2196 -17.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5031 -16.8820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9342 -16.8926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6491 -17.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3616 -16.9015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3654 -16.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6475 -15.6601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9352 -16.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0731 -18.5423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3613 -18.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7486 -18.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0887 -19.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9046 -19.3514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9452 -18.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6861 -17.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8806 -17.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3286 -18.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5908 -18.9652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3955 -19.1330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6760 -20.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8492 -20.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4400 -20.8671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8558 -21.5828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6831 -21.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0909 -20.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4962 -19.3678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9320 -18.5440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0820 -15.6637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0436 -19.5828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6248 -16.7776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4478 -22.2971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6471 -14.8350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
3 7 1 1
7 8 1 0
4 9 1 6
5 10 1 1
6 11 1 6
1 12 1 1
13 28 2 0
27 16 2 0
15 14 2 0
14 13 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
19 21 1 1
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
29 32 1 1
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
30 38 1 6
17 44 2 0
18 45 1 6
24 46 1 0
36 47 1 0
34 48 1 0
41 49 1 0
25 50 1 0
13 12 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 692.63Molecular Weight (Monoisotopic): 692.1741AlogP: 1.34#Rotatable Bonds: 6Polar Surface Area: 256.29Molecular Species: NEUTRALHBA: 15HBD: 10#RO5 Violations: 3HBA (Lipinski): 15HBD (Lipinski): 10#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.90CX Basic pKa: ┄CX LogP: 1.46CX LogD: 1.44Aromatic Rings: 4Heavy Atoms: 50QED Weighted: 0.13Np Likeness Score: 2.03
References 1. Cho HM,Lee YR,Lee BW,Zhang M,Ryu B,Nghiem DT,Pham HT,Oh WK. (2020) Phenolic Constituents of the Roots of Rhamnoneuron balansae with Senolytic Activity., 83 (12): [PMID:33256407 ] [10.1021/acs.jnatprod.0c00885 ]