(2S,3R,11bR)-3-isobutyl-9,10-bis(trideuteriomethoxy)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol

ID: ALA4792500

Cas Number: 1583277-32-0

PubChem CID: 76973985

Max Phase: Preclinical

Molecular Formula: C19H29NO3

Molecular Weight: 319.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  [2H]C([2H])([2H])Oc1cc2c(cc1OC([2H])([2H])[2H])[C@H]1C[C@H](O)[C@H](CC(C)C)CN1CC2

Standard InChI:  InChI=1S/C19H29NO3/c1-12(2)7-14-11-20-6-5-13-8-18(22-3)19(23-4)9-15(13)16(20)10-17(14)21/h8-9,12,14,16-17,21H,5-7,10-11H2,1-4H3/t14-,16-,17+/m1/s1/i3D3,4D3

Standard InChI Key:  WEQLWGNDNRARGE-HAXSNHTFSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    4.7213   -4.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4385   -3.5930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1477   -4.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1477   -4.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4411   -5.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7213   -4.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0081   -5.2480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0081   -6.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2950   -6.4839    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7213   -6.4839    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0081   -6.8945    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8609   -5.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5740   -4.8280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5740   -4.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8609   -3.5921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2912   -5.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2912   -6.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5739   -6.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8609   -6.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5739   -7.3040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0044   -6.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7175   -6.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4348   -6.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7175   -5.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1477   -5.6533    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0081   -3.5926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2950   -4.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5777   -3.5926    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2950   -4.8285    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5777   -4.4180    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
  4 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  3 15  1  0
 13 16  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 12 19  1  0
 18 20  1  1
 17 21  1  1
 21 22  1  0
 22 23  1  0
 22 24  1  0
 12 25  1  1
  1 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  ISO  6   9   2  10   2  11   2  28   2  29   2  30   2
M  END

Associated Targets(non-human)

Slc18a2 Synaptic vesicular amine transporter (631 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 319.45Molecular Weight (Monoisotopic): 319.2147AlogP: 3.03#Rotatable Bonds: 4
Polar Surface Area: 41.93Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.18CX LogP: 2.67CX LogD: 1.83
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.93Np Likeness Score: 1.19

References

1. Shanu-Wilson J,Evans L,Wrigley S,Steele J,Atherton J,Boer J.  (2020)  Biotransformation: Impact and Application of Metabolism in Drug Discovery.,  11  (11): [PMID:33214818] [10.1021/acsmedchemlett.0c00202]

Source