The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(ethane-1,2-diyl)bis(7-(benzyloxy)-2-oxo-2H-chromene-3-carboxamide) ID: ALA4792716
PubChem CID: 162670752
Max Phase: Preclinical
Molecular Formula: C36H28N2O8
Molecular Weight: 616.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCNC(=O)c1cc2ccc(OCc3ccccc3)cc2oc1=O)c1cc2ccc(OCc3ccccc3)cc2oc1=O
Standard InChI: InChI=1S/C36H28N2O8/c39-33(29-17-25-11-13-27(19-31(25)45-35(29)41)43-21-23-7-3-1-4-8-23)37-15-16-38-34(40)30-18-26-12-14-28(20-32(26)46-36(30)42)44-22-24-9-5-2-6-10-24/h1-14,17-20H,15-16,21-22H2,(H,37,39)(H,38,40)
Standard InChI Key: LGJOLCSLFKZDOR-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
7.1800 -18.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1788 -19.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8869 -20.1023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5965 -19.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5937 -18.8702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8851 -18.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2999 -18.4589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0091 -18.8648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3049 -20.1003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0119 -19.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7207 -20.0974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7153 -18.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7124 -17.6365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4245 -18.8597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4708 -20.1014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7634 -19.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0554 -20.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3467 -19.6925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6391 -20.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6380 -20.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3504 -21.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0550 -20.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1307 -18.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8399 -18.8546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5461 -18.4435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2553 -18.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9616 -18.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2583 -19.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9586 -17.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6648 -17.2101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6707 -18.8445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2494 -17.2152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3713 -17.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3770 -18.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0873 -18.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7925 -18.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7829 -17.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0719 -17.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4856 -17.1825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1982 -17.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9009 -17.1654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6131 -17.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3154 -17.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3059 -16.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5883 -15.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8891 -16.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
4 9 1 0
8 10 1 0
9 10 1 0
10 11 2 0
8 12 1 0
12 13 2 0
12 14 1 0
2 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
14 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 31 2 0
27 29 1 0
29 30 1 0
30 33 1 0
34 31 1 0
29 32 2 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
37 39 1 0
39 40 1 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 616.63Molecular Weight (Monoisotopic): 616.1846AlogP: 5.22#Rotatable Bonds: 11Polar Surface Area: 137.08Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.94CX Basic pKa: ┄CX LogP: 4.54CX LogD: 4.54Aromatic Rings: 6Heavy Atoms: 46QED Weighted: 0.15Np Likeness Score: -0.40
References 1. Ji H,Tan Y,Gan N,Zhang J,Li S,Zheng X,Wang Z,Yi W. (2021) Synthesis and anticancer activity of new coumarin-3-carboxylic acid derivatives as potential lactatetransportinhibitors., 29 [PMID:33221062 ] [10.1016/j.bmc.2020.115870 ]