2-(5-nitrothiophen-2-yl)-N-(4-(trifluoromethyl)phenyl)-1H-benzo[d]imidazole-5-carboxamide

ID: ALA4792824

PubChem CID: 162672160

Max Phase: Preclinical

Molecular Formula: C19H11F3N4O3S

Molecular Weight: 432.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc2[nH]c(-c3ccc([N+](=O)[O-])s3)nc2c1

Standard InChI:  InChI=1S/C19H11F3N4O3S/c20-19(21,22)11-2-4-12(5-3-11)23-18(27)10-1-6-13-14(9-10)25-17(24-13)15-7-8-16(30-15)26(28)29/h1-9H,(H,23,27)(H,24,25)

Standard InChI Key:  QFYYCIKWVWIDMD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    6.0733   -6.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0721   -7.6353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7869   -8.0482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7851   -6.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5004   -6.8044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5053   -7.6308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2927   -7.8815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7747   -7.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2849   -6.5444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6007   -7.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0896   -7.8688    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.8727   -7.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8679   -6.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0818   -6.5340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5462   -8.0924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2978   -7.7524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4648   -8.9134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3574   -8.0472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6432   -7.6342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3568   -8.8722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9285   -8.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2152   -7.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5009   -8.0421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4997   -8.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2189   -9.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9302   -8.8672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7855   -9.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0709   -8.8686    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.7860  -10.1058    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.0666   -9.6870    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  8 10  1  0
 15 16  2  0
 15 17  1  0
 12 15  1  0
  2 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA4792824

    ---

Associated Targets(non-human)

Hemozoin (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.38Molecular Weight (Monoisotopic): 432.0504AlogP: 5.47#Rotatable Bonds: 4
Polar Surface Area: 100.92Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.78CX Basic pKa: 3.29CX LogP: 5.14CX LogD: 5.14
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.33Np Likeness Score: -1.99

References

1. Sharma, Mousmee, Prasher, Parteek.  (2020)  An epigrammatic status of the azole-based antimalarial drugs,  11  (2): [PMID:33479627] [10.1039/c9md00479c]

Source