The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(5-methyl-2((4-(piperazin-1-yl)phenyl)amino)-8-(pyrrolidine-1-carbonyl)imidazo[1',2':1,6]pyrido[2,3-d]pyrimidin-6-yl)ethan-1-one ID: ALA4792839
PubChem CID: 162672308
Max Phase: Preclinical
Molecular Formula: C27H30N8O2
Molecular Weight: 498.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1c(C)c2cnc(Nc3ccc(N4CCNCC4)cc3)nc2n2cc(C(=O)N3CCCC3)nc12
Standard InChI: InChI=1S/C27H30N8O2/c1-17-21-15-29-27(30-19-5-7-20(8-6-19)33-13-9-28-10-14-33)32-24(21)35-16-22(26(37)34-11-3-4-12-34)31-25(35)23(17)18(2)36/h5-8,15-16,28H,3-4,9-14H2,1-2H3,(H,29,30,32)
Standard InChI Key: HHCHQSDJGQGHPG-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
18.5691 -30.4619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5679 -31.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2827 -31.7022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2810 -30.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9963 -30.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9971 -31.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4226 -30.4514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7068 -30.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4274 -31.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7108 -31.6927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8805 -32.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7021 -32.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0401 -31.8359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7024 -29.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8532 -31.7012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1390 -31.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1443 -30.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4310 -30.0503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7152 -30.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7172 -31.2916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4311 -31.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0005 -30.0502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9983 -29.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2877 -28.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5710 -29.2224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5695 -30.0483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2847 -30.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1321 -30.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8500 -30.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1252 -29.2089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1128 -33.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6985 -34.0188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9378 -33.3074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4240 -33.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2093 -33.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2113 -32.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4274 -32.6382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 2 0
8 14 1 0
2 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
7 28 1 0
28 29 1 0
28 30 2 0
12 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.59Molecular Weight (Monoisotopic): 498.2492AlogP: 3.18#Rotatable Bonds: 5Polar Surface Area: 107.76Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.91CX LogP: 2.07CX LogD: 0.55Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.40Np Likeness Score: -1.27
References 1. Shi C,Wang Q,Liao X,Ge H,Huo G,Zhang L,Chen N,Zhai X,Hong Y,Wang L,Wang Z,Shi W,Mao Y,Yu J,Ke Y,Xia G. (2020) Discovery of a novel series of imidazo[1',2':1,6]pyrido[2,3-d]pyrimidin derivatives as potent cyclin-dependent kinase 4/6 inhibitors., 193 [PMID:32200202 ] [10.1016/j.ejmech.2020.112239 ]