The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-chloro-3-(trifluoromethyl)phenyl)-3-(5-oxo-6-(pyridin-4-yl)-5,6-dihydrobenzo[b]pyrido[3,2-f][1,4]oxazepin-9-yl)urea ID: ALA4792974
PubChem CID: 154815588
Max Phase: Preclinical
Molecular Formula: C25H15ClF3N5O3
Molecular Weight: 525.87
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc2c(c1)Oc1ncccc1C(=O)N2c1ccncc1)Nc1ccc(Cl)c(C(F)(F)F)c1
Standard InChI: InChI=1S/C25H15ClF3N5O3/c26-19-5-3-14(12-18(19)25(27,28)29)32-24(36)33-15-4-6-20-21(13-15)37-22-17(2-1-9-31-22)23(35)34(20)16-7-10-30-11-8-16/h1-13H,(H2,32,33,36)
Standard InChI Key: NQHGDUGVQSAKOR-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
12.6707 -13.4581 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.8707 -13.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0846 -14.0412 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.7235 -11.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0119 -10.7616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0677 -11.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4226 -10.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2287 -10.6573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8727 -11.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8727 -11.9991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2287 -12.5118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4226 -12.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9642 -10.1651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1428 -10.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7795 -10.9681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2462 -11.6467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5843 -12.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3002 -11.9991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3002 -11.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5843 -10.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3716 -14.3507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1971 -13.5573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3990 -13.3053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8192 -13.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9937 -14.6785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7877 -14.9346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9141 -12.9693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7237 -12.0033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4421 -10.7573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1608 -11.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1556 -12.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8735 -12.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5930 -12.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5902 -11.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8717 -10.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3123 -12.4121 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.1545 -13.6588 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
6 12 1 0
13 14 1 0
14 15 2 0
15 16 1 0
6 16 2 0
7 13 2 0
17 18 1 0
18 19 2 0
19 20 1 0
9 20 2 0
10 17 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
21 26 2 0
11 23 1 0
12 27 2 0
5 19 1 0
4 28 2 0
4 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
32 2 1 0
2 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 525.87Molecular Weight (Monoisotopic): 525.0816AlogP: 6.88#Rotatable Bonds: 3Polar Surface Area: 96.45Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.33CX Basic pKa: 4.18CX LogP: 4.90CX LogD: 4.90Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -1.58
References 1. Martínez-González S,García AB,Albarrán MI,Cebriá A,Amezquita-Alves A,García-Campos FJ,Martínez-Gago J,Martínez-Torrecuadrada J,Muñoz IG,Blanco-Aparicio C,Pastor J. (2020) Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one derivatives as CDK8 inhibitors., 201 [PMID:32599324 ] [10.1016/j.ejmech.2020.112443 ]