The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(2-((6-(2-((2,6-Dichloro-3,5-dimethoxyphenyl)amino)-pyridin-3-yl)pyrimidin-4-yl)amino)-3-methylphenyl)-4-(methyl-(prop-2-yn-1-yl)amino)but-2-enamide ID: ALA4793111
PubChem CID: 146450691
Max Phase: Preclinical
Molecular Formula: C32H31Cl2N7O3
Molecular Weight: 632.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(C)C/C=C/C(=O)Nc1cccc(C)c1Nc1cc(-c2cccnc2Nc2c(Cl)c(OC)cc(OC)c2Cl)ncn1
Standard InChI: InChI=1S/C32H31Cl2N7O3/c1-6-15-41(3)16-9-13-27(42)38-22-12-7-10-20(2)30(22)39-26-17-23(36-19-37-26)21-11-8-14-35-32(21)40-31-28(33)24(43-4)18-25(44-5)29(31)34/h1,7-14,17-19H,15-16H2,2-5H3,(H,35,40)(H,38,42)(H,36,37,39)/b13-9+
Standard InChI Key: FHIIVOKGJMASBO-UKTHLTGXSA-N
Molfile:
RDKit 2D
44 47 0 0 0 0 0 0 0 0999 V2000
22.1427 -15.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5769 -18.3105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1350 -14.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1515 -19.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9947 -12.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7160 -17.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7242 -20.3710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7121 -14.1865 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.1381 -15.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4366 -19.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2774 -13.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0062 -18.3062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4311 -15.4330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8578 -17.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8610 -17.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2799 -14.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0076 -19.1318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7186 -17.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8561 -15.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9993 -14.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1442 -18.3177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0023 -15.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9950 -16.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5634 -16.6657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7172 -15.8448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8522 -15.8459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2817 -15.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2815 -17.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4247 -14.6095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4292 -17.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7228 -19.5454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4295 -17.0813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8551 -14.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2897 -17.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5681 -14.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2815 -16.6725 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.5669 -15.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1454 -16.6670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8636 -19.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5750 -19.5439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2872 -19.1334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5744 -20.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9986 -19.5450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7110 -19.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 31 1 0
26 9 1 0
20 8 1 0
35 37 2 0
1 19 1 0
27 22 2 0
18 6 2 0
25 13 1 0
32 30 1 0
20 16 2 0
29 13 1 0
1 38 1 0
31 10 1 0
23 28 2 0
21 15 1 0
27 36 1 0
10 4 2 0
12 18 1 0
12 17 1 0
34 12 2 0
3 29 2 0
14 38 1 0
30 21 2 0
16 11 1 0
22 25 1 0
37 27 1 0
31 7 2 0
15 14 2 0
28 34 1 0
22 20 1 0
2 34 1 0
13 1 2 0
28 24 1 0
11 5 1 0
16 35 1 0
15 2 1 0
33 3 1 0
37 26 1 0
38 32 2 0
19 33 2 0
6 23 1 0
4 39 1 0
39 40 1 0
40 41 1 0
40 42 1 0
41 43 1 0
43 44 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 632.55Molecular Weight (Monoisotopic): 631.1865AlogP: 6.72#Rotatable Bonds: 12Polar Surface Area: 113.53Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.03CX Basic pKa: 7.90CX LogP: 6.38CX LogD: 5.76Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.12Np Likeness Score: -0.86
References 1. Rezende Miranda R,Fu Y,Chen X,Perino J,Cao P,Carpten J,Chen Y,Zhang C. (2020) Development of a Potent and Specific FGFR4 Inhibitor for the Treatment of Hepatocellular Carcinoma., 63 (20): [PMID:33030342 ] [10.1021/acs.jmedchem.0c00044 ]