The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-(4-Methoxybenzofuran-5-yl)-3-phenyl-1H-pyrazol-1-yl)benzonitrile ID: ALA4793151
PubChem CID: 162671729
Max Phase: Preclinical
Molecular Formula: C25H17N3O2
Molecular Weight: 391.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(-c2cc(-c3ccccc3)nn2-c2ccc(C#N)cc2)ccc2occc12
Standard InChI: InChI=1S/C25H17N3O2/c1-29-25-20(11-12-24-21(25)13-14-30-24)23-15-22(18-5-3-2-4-6-18)27-28(23)19-9-7-17(16-26)8-10-19/h2-15H,1H3
Standard InChI Key: KULLUQBZTBYETK-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
2.9567 -20.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6647 -21.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3744 -20.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3715 -19.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9578 -19.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6627 -19.4177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4873 -18.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6738 -18.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3467 -19.2886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0787 -19.4182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0776 -18.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0827 -21.0578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1699 -21.8680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9696 -22.0366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3771 -21.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8292 -20.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1868 -21.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6678 -21.9021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4797 -21.8157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8116 -21.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3256 -20.4058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5154 -20.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4574 -22.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7530 -21.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0410 -22.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0328 -23.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7427 -23.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4519 -23.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3202 -23.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6093 -23.8797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5 1 2 0
1 2 1 0
2 3 2 0
3 4 1 0
4 6 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
4 10 1 0
10 11 1 0
3 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
15 17 1 0
13 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
29 30 3 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 391.43Molecular Weight (Monoisotopic): 391.1321AlogP: 5.83#Rotatable Bonds: 4Polar Surface Area: 63.98Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.31CX LogP: 5.52CX LogD: 5.52Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -0.73
References 1. Sharma R,Williams IS,Gatchie L,Sonawane VR,Chaudhuri B,Bharate SB. (2018) Furanoflavones pongapin and lanceolatin B blocks the cell cycle and induce senescence in CYP1A1-overexpressing breast cancer cells., 26 (23-24): [PMID:30448188 ] [10.1016/j.bmc.2018.11.013 ]