(S)-2-(2-(4-(dimethylamino)phenyl)acetamido)-N1-(3-morpholinobenzyl)pentanediamide

ID: ALA4793194

PubChem CID: 162672064

Max Phase: Preclinical

Molecular Formula: C26H35N5O4

Molecular Weight: 481.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(CC(=O)N[C@@H](CCC(N)=O)C(=O)NCc2cccc(N3CCOCC3)c2)cc1

Standard InChI:  InChI=1S/C26H35N5O4/c1-30(2)21-8-6-19(7-9-21)17-25(33)29-23(10-11-24(27)32)26(34)28-18-20-4-3-5-22(16-20)31-12-14-35-15-13-31/h3-9,16,23H,10-15,17-18H2,1-2H3,(H2,27,32)(H,28,34)(H,29,33)/t23-/m0/s1

Standard InChI Key:  ZICPZMJZSIENNH-QHCPKHFHSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   28.5631  -24.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5620  -25.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2700  -26.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9797  -25.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9769  -24.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2682  -24.4081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8540  -26.0446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1466  -25.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8533  -26.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6830  -24.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3923  -24.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0984  -24.3968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3954  -25.6252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8077  -24.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5138  -24.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5108  -23.5743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2231  -24.7974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8108  -25.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5200  -26.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5231  -26.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2323  -27.2489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8169  -27.2543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9292  -24.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6385  -24.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6389  -25.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3473  -26.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0545  -25.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0488  -24.7795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3398  -24.3774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7535  -24.3658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.4641  -24.7692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7475  -23.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4522  -23.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1629  -23.5383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.1689  -24.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  7  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  6
 14 15  1  0
 15 16  2  0
 15 17  1  0
 14 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 17 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 31 35  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4793194

    ---

Associated Targets(Human)

TYR Tclin Tyrosinase (717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 481.60Molecular Weight (Monoisotopic): 481.2689AlogP: 1.20#Rotatable Bonds: 11
Polar Surface Area: 117.00Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.77CX Basic pKa: 4.89CX LogP: 1.05CX LogD: 1.05
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.44Np Likeness Score: -1.27

References

1. Catalano M, Bassi G, Rotondi G, Khettabi L, Dichiara M, Murer P, Scheuermann J, Soler-Lopez M, Neri D..  (2021)  Discovery, affinity maturation and multimerization of small molecule ligands against human tyrosinase and tyrosinase-related protein 1.,  12  (3.0): [PMID:34041485] [10.1039/D0MD00310G]

Source