The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((4-(6-(3-fluorophenyl)imidazo[2,1-b]thiazol-5-yl)pyrimidin-2-yl)amino)propyl)-4-methoxybenzenesulfonamide ID: ALA4793221
PubChem CID: 162670338
Max Phase: Preclinical
Molecular Formula: C25H23FN6O3S2
Molecular Weight: 538.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)NCCCNc2nccc(-c3c(-c4cccc(F)c4)nc4sccn34)n2)cc1
Standard InChI: InChI=1S/C25H23FN6O3S2/c1-35-19-6-8-20(9-7-19)37(33,34)29-12-3-11-27-24-28-13-10-21(30-24)23-22(17-4-2-5-18(26)16-17)31-25-32(23)14-15-36-25/h2,4-10,13-16,29H,3,11-12H2,1H3,(H,27,28,30)
Standard InChI Key: ISUARVWWATUXNL-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
40.4056 -12.7160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.9875 -13.2979 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.2005 -12.5030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8224 -12.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8213 -13.2837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5293 -13.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2431 -13.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2403 -12.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5275 -12.0471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9484 -12.0427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7003 -12.3764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0307 -11.2256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8335 -11.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2433 -11.7616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0432 -11.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1293 -10.7807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3827 -10.4449 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.8739 -13.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2686 -13.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4436 -14.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2273 -14.7803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8322 -14.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6541 -13.4208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6161 -14.4648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2218 -13.9075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1105 -12.0475 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.0057 -14.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6090 -13.6049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3880 -13.8519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.7704 -13.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9439 -14.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7259 -14.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3346 -14.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1559 -13.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3741 -12.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1134 -14.2936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2886 -15.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 14 1 0
13 12 2 0
12 10 1 0
8 10 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
11 18 1 0
22 24 1 0
24 25 1 0
4 26 1 0
25 27 1 0
27 28 1 0
28 29 1 0
29 2 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.63Molecular Weight (Monoisotopic): 538.1257AlogP: 4.45#Rotatable Bonds: 10Polar Surface Area: 110.51Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.45CX Basic pKa: 3.52CX LogP: 3.68CX LogD: 3.68Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: -2.00
References 1. Abdel-Maksoud MS,Ammar UM,Oh CH. (2019) Anticancer profile of newly synthesized BRAF inhibitors possess 5-(pyrimidin-4-yl)imidazo[2,1-b]thiazole scaffold., 27 (10.0): [PMID:30955995 ] [10.1016/j.bmc.2019.03.062 ]