2-(5-nitrofuran-2-yl)-N-o-tolyl-1H-benzo[d]imidazole-5-carboxamide

ID: ALA4793469

PubChem CID: 135391724

Max Phase: Preclinical

Molecular Formula: C19H14N4O4

Molecular Weight: 362.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccccc1NC(=O)c1ccc2[nH]c(-c3ccc([N+](=O)[O-])o3)nc2c1

Standard InChI:  InChI=1S/C19H14N4O4/c1-11-4-2-3-5-13(11)22-19(24)12-6-7-14-15(10-12)21-18(20-14)16-8-9-17(27-16)23(25)26/h2-10H,1H3,(H,20,21)(H,22,24)

Standard InChI Key:  PKSSAJZPBITULB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   33.0174   -3.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0162   -4.0063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7310   -4.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7292   -2.7662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4445   -3.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4494   -4.0017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2368   -4.2525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7187   -3.5811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2290   -2.9154    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.5448   -3.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0337   -4.2398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8167   -3.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8118   -3.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0258   -2.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4902   -4.4634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2418   -4.1234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.4088   -5.2843    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3015   -4.4181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5873   -4.0052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3007   -5.2431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8726   -4.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1592   -4.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4450   -4.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4439   -5.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1630   -5.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8743   -5.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1612   -3.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  8 10  1  0
 15 16  2  0
 15 17  1  0
 12 15  1  0
  2 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 22 27  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA4793469

    ---

Associated Targets(non-human)

Hemozoin (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.35Molecular Weight (Monoisotopic): 362.1015AlogP: 4.29#Rotatable Bonds: 4
Polar Surface Area: 114.06Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.15CX Basic pKa: 2.72CX LogP: 3.98CX LogD: 3.97
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.42Np Likeness Score: -1.89

References

1. Sharma, Mousmee, Prasher, Parteek.  (2020)  An epigrammatic status of the azole-based antimalarial drugs,  11  (2): [PMID:33479627] [10.1039/c9md00479c]

Source