Methyl (R)-4-(6-chloro-4((5-cyclopropyl-1H-pyrazol-3-yl)amino)quinazoline-2-carbonyl)-2-methyl piperazine-1-carboxylate

ID: ALA4793730

PubChem CID: 153529969

Max Phase: Preclinical

Molecular Formula: C22H24ClN7O3

Molecular Weight: 469.93

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)N1CCN(C(=O)c2nc(Nc3cc(C4CC4)[nH]n3)c3cc(Cl)ccc3n2)C[C@H]1C

Standard InChI:  InChI=1S/C22H24ClN7O3/c1-12-11-29(7-8-30(12)22(32)33-2)21(31)20-24-16-6-5-14(23)9-15(16)19(26-20)25-18-10-17(27-28-18)13-3-4-13/h5-6,9-10,12-13H,3-4,7-8,11H2,1-2H3,(H2,24,25,26,27,28)/t12-/m1/s1

Standard InChI Key:  ZEBCQLDGXKNHCF-GFCCVEGCSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    3.4324   -4.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4313   -5.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1393   -6.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1375   -4.5479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8462   -4.9532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8469   -5.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5555   -6.1792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2637   -5.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2590   -4.9463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5499   -4.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7246   -4.5483    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.5455   -3.7258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2511   -3.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9965   -3.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5401   -3.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1277   -2.3257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3294   -2.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3501   -3.1095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0138   -3.5863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0949   -2.7732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9730   -6.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9762   -6.9914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6791   -5.7629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3857   -6.1726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0897   -5.7647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0907   -4.9472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3816   -4.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6714   -4.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7974   -6.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8005   -4.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5082   -4.9442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8004   -3.7185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2159   -4.5356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 13  2  0
 19 18  1  0
 20 19  1  0
 18 20  1  0
 15 18  1  0
  8 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 25 29  1  6
 30 31  1  0
 30 32  2  0
 26 30  1  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4793730

    ---

Associated Targets(Human)

PAK4 Tchem Serine/threonine-protein kinase PAK 4 (3212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.93Molecular Weight (Monoisotopic): 469.1629AlogP: 3.54#Rotatable Bonds: 4
Polar Surface Area: 116.34Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.18CX Basic pKa: 2.97CX LogP: 3.52CX LogD: 3.52
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.60Np Likeness Score: -1.49

References

1. Guo J,Wang T,Wu T,Zhang K,Yin W,Zhu M,Pang Y,Hao C,He Z,Cheng M,Liu Y,Zheng J,Gu J,Zhao D.  (2020)  Synthesis, bioconversion, pharmacokinetic and pharmacodynamic evaluation of N-isopropyl-oxy-carbonyloxymethyl prodrugs of CZh-226, a potent and selective PAK4 inhibitor.,  186  [PMID:31757524] [10.1016/j.ejmech.2019.111878]

Source