N-(5-((4-(1-cyclopropyl-1H-indol-3-yl)pyrimidin-2-yl)amino)-2-((2-(dimethylamino)ethyl)thio)-4-methoxyphenyl)acrylamide

ID: ALA4793880

PubChem CID: 162673384

Max Phase: Preclinical

Molecular Formula: C29H32N6O2S

Molecular Weight: 528.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C4CC4)c4ccccc34)n2)c(OC)cc1SCCN(C)C

Standard InChI:  InChI=1S/C29H32N6O2S/c1-5-28(36)31-24-16-23(26(37-4)17-27(24)38-15-14-34(2)3)33-29-30-13-12-22(32-29)21-18-35(19-10-11-19)25-9-7-6-8-20(21)25/h5-9,12-13,16-19H,1,10-11,14-15H2,2-4H3,(H,31,36)(H,30,32,33)

Standard InChI Key:  IAQAOPIEFDZYHP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   32.6648   -4.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6636   -5.6273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3784   -6.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0948   -5.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0920   -4.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3766   -4.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8061   -4.3830    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.5157   -4.7972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2278   -4.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3740   -6.8669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6573   -7.2757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9454   -6.0375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2329   -5.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2395   -4.7963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.5279   -4.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8104   -4.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8092   -5.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5214   -6.0310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.5318   -3.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2018   -3.0724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9509   -2.2865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4393   -1.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8671   -3.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1294   -2.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5844   -1.6683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7770   -1.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5174   -2.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0641   -3.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9416   -4.8011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3794   -3.5608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6663   -3.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6690   -2.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9504   -3.5560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3849   -1.9109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1963   -1.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5314   -0.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6567   -4.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9405   -5.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  3 10  1  0
 10 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 19 20  2  0
 20 21  1  0
 21 24  1  0
 23 19  1  0
 15 19  1  0
 21 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  9 29  1  0
  6 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 32 34  2  0
 35 22  1  0
 36 35  1  0
 22 36  1  0
 29 37  1  0
 29 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4793880

    ---

Associated Targets(Human)

PC-9 (1037 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H1975 (4994 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H292 (733 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.68Molecular Weight (Monoisotopic): 528.2307AlogP: 5.96#Rotatable Bonds: 11
Polar Surface Area: 84.31Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.68CX Basic pKa: 8.64CX LogP: 5.21CX LogD: 3.95
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: -1.12

References

1. Li J,An B,Song X,Zhang Q,Chen C,Wei S,Fan R,Li X,Zou Y.  (2021)  Design, synthesis and biological evaluation of novel 2,4-diaryl pyrimidine derivatives as selective EGFR inhibitors.,  212  [PMID:33429247] [10.1016/j.ejmech.2020.113019]

Source