3,5-dichloro-N-[3-chloro-4-(4-hydroxyphenoxy)phenyl]-2-hydroxy-benzamide

ID: ALA4793886

PubChem CID: 162673390

Max Phase: Preclinical

Molecular Formula: C19H12Cl3NO4

Molecular Weight: 424.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Oc2ccc(O)cc2)c(Cl)c1)c1cc(Cl)cc(Cl)c1O

Standard InChI:  InChI=1S/C19H12Cl3NO4/c20-10-7-14(18(25)16(22)8-10)19(26)23-11-1-6-17(15(21)9-11)27-13-4-2-12(24)3-5-13/h1-9,24-25H,(H,23,26)

Standard InChI Key:  MWTOGDXGFLZURM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    2.5927  -27.8056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5935  -28.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3061  -29.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0144  -28.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0097  -27.7988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3005  -27.3954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7278  -29.0350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4380  -28.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1487  -29.0339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8584  -28.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8557  -27.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1373  -27.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4304  -27.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1490  -29.8552    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.5654  -27.3846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2793  -27.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9890  -27.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2836  -28.6109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6973  -27.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4065  -27.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4027  -26.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6837  -26.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9816  -26.5598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2660  -26.1535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6766  -25.3204    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.1203  -27.7780    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.8845  -27.3979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  9 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 23 24  1  0
 22 25  1  0
 20 26  1  0
  1 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4793886

    ---

Associated Targets(Human)

STK39 Tchem STE20/SPS1-related proline-alanine-rich protein kinase (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.67Molecular Weight (Monoisotopic): 422.9832AlogP: 6.10#Rotatable Bonds: 4
Polar Surface Area: 78.79Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.95CX Basic pKa: CX LogP: 5.77CX LogD: 4.40
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.47Np Likeness Score: -0.97

References

1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H.  (2020)  Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling.,  30  (17): [PMID:32738993] [10.1016/j.bmcl.2020.127408]

Source