(3S,5S,8R,9S,10S,13S,14S)-17-(isoquinolin-7-yl)-N,N,10,13-tetramethyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine

ID: ALA4793909

PubChem CID: 44185512

Max Phase: Preclinical

Molecular Formula: C30H40N2

Molecular Weight: 428.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(c4ccc5ccncc5c4)=CC[C@@H]32)C1

Standard InChI:  InChI=1S/C30H40N2/c1-29-14-11-24(32(3)4)18-23(29)7-8-25-27-10-9-26(30(27,2)15-12-28(25)29)21-6-5-20-13-16-31-19-22(20)17-21/h5-6,9,13,16-17,19,23-25,27-28H,7-8,10-12,14-15,18H2,1-4H3/t23-,24-,25-,27-,28-,29-,30+/m0/s1

Standard InChI Key:  OMXPPLKRCNPLSE-OTFSTGPRSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   14.0573   -6.0381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0573   -6.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7626   -7.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7626   -5.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4679   -6.0381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4644   -6.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1665   -7.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8765   -6.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1734   -5.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8761   -6.0466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8929   -4.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1787   -4.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5956   -4.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5867   -5.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3579   -5.9060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8435   -5.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3722   -4.5894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3502   -7.2649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4606   -5.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8680   -5.2292    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.5902   -4.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1664   -6.4467    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.5820   -6.4632    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.6318   -3.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4343   -3.6553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3502   -2.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0929   -3.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1481   -2.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6915   -2.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4989   -2.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7640   -1.9396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2155   -1.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4101   -1.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6419   -6.8574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3514   -8.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4565   -7.6684    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
  2 18  1  1
  5 19  1  1
 10 20  1  1
 13 21  1  1
  9 22  1  6
 14 23  1  6
 24 25  2  0
 25 29  1  0
 28 26  1  0
 26 27  2  0
 27 24  1  0
 17 24  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 28  2  0
 18 34  1  0
 18 35  1  0
  6 36  1  6
M  END

Associated Targets(Human)

CDK8 Tchem Cell division protein kinase 8 (1536 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.66Molecular Weight (Monoisotopic): 428.3191AlogP: 7.20#Rotatable Bonds: 2
Polar Surface Area: 16.13Molecular Species: BASEHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.20CX LogP: 6.07CX LogD: 3.34
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: 1.48

References

1.  (2019)  Cyclin-dependent kinase inhibitors and methods of use, 

Source