(10,11-Dihydro-5H-dibenzo[b,f]azepin-5-yl)(4-(3-morpholinopropoxy)phenyl)methanone

ID: ALA4794057

PubChem CID: 162673013

Max Phase: Preclinical

Molecular Formula: C28H30N2O3

Molecular Weight: 442.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(OCCCN2CCOCC2)cc1)N1c2ccccc2CCc2ccccc21

Standard InChI:  InChI=1S/C28H30N2O3/c31-28(24-12-14-25(15-13-24)33-19-5-16-29-17-20-32-21-18-29)30-26-8-3-1-6-22(26)10-11-23-7-2-4-9-27(23)30/h1-4,6-9,12-15H,5,10-11,16-21H2

Standard InChI Key:  VFEFRFUXSHOSQX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    4.5303  -20.9787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5291  -21.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2413  -22.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9551  -21.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9523  -20.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2395  -20.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6676  -22.2135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3746  -21.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0871  -22.2112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7983  -21.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5108  -22.2090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8183  -20.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1066  -20.9790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8181  -19.7489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5121  -23.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2220  -21.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9345  -22.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9357  -23.0281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2245  -23.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4036  -17.9473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2238  -17.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7373  -18.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5549  -19.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1546  -19.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9370  -19.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1162  -18.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5151  -18.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0806  -19.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8947  -18.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1075  -18.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5054  -18.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6958  -19.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4827  -19.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  1 12  1  0
 12 13  2  0
 12 14  1  0
 11 15  1  0
 11 16  1  0
 16 17  1  0
 15 19  1  0
 17 18  1  0
 18 19  1  0
 14 28  1  0
 14 23  1  0
 29 20  1  0
 20 21  1  0
 22 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4794057

    ---

Associated Targets(Human)

CACNA1B Tclin Voltage-gated N-type calcium channel alpha-1B subunit (743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1H Tclin Voltage-gated T-type calcium channel alpha-1H subunit (1913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.56Molecular Weight (Monoisotopic): 442.2256AlogP: 4.86#Rotatable Bonds: 6
Polar Surface Area: 42.01Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.00CX LogP: 4.85CX LogD: 4.71
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.07

References

1. Cardoso FC,Marliac MA,Geoffroy C,Schmit M,Bispat A,Lewis RJ,Tuck KL,Duggan PJ.  (2020)  The neuronal calcium ion channel activity of constrained analogues of MONIRO-1.,  28  (18): [PMID:32828422] [10.1016/j.bmc.2020.115655]

Source