(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-3-(2-chlorophenyl)-1-(hydroxyamino)-1-oxopropan-2-yl)-4-phenylbutanamide

ID: ALA4794105

PubChem CID: 162673539

Max Phase: Preclinical

Molecular Formula: C31H35ClN4O6

Molecular Weight: 595.10

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1ccccc1Cl)C(=O)NO

Standard InChI:  InChI=1S/C31H35ClN4O6/c1-21(37)33-28(20-42-19-23-12-6-3-7-13-23)30(39)34-26(17-16-22-10-4-2-5-11-22)29(38)35-27(31(40)36-41)18-24-14-8-9-15-25(24)32/h2-15,26-28,41H,16-20H2,1H3,(H,33,37)(H,34,39)(H,35,38)(H,36,40)/t26-,27-,28+/m1/s1

Standard InChI Key:  GPIQYMLXVBUOTJ-FCEKVYKBSA-N

Molfile:  

 
     RDKit          2D

 42 44  0  0  0  0  0  0  0  0999 V2000
   31.1710   -4.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8855   -4.2916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4566   -4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1710   -5.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6000   -4.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3144   -4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0289   -4.7042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3144   -3.4667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7434   -4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4578   -4.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7434   -3.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4578   -5.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.1724   -4.2916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.8869   -4.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6013   -4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8869   -5.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6013   -5.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3158   -4.7042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.0303   -4.2916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.6013   -3.4667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5975   -6.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3111   -7.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0265   -6.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0239   -5.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3096   -5.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6000   -5.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3144   -5.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3144   -6.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0289   -7.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0266   -8.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7402   -8.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4557   -8.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4531   -7.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7388   -6.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4578   -3.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4578   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1743   -1.8179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1747   -0.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4596   -0.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7429   -0.9973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7460   -1.8202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8819   -7.1785    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  6
 10 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  1
 16 17  1  0
 15 18  1  0
 18 19  1  0
 15 20  2  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
  5 26  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 11 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 21 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4794105

    ---

Associated Targets(Human)

MMP12 Tchem Matrix metalloproteinase 12 (1130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 595.10Molecular Weight (Monoisotopic): 594.2245AlogP: 2.71#Rotatable Bonds: 15
Polar Surface Area: 145.86Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.72CX Basic pKa: CX LogP: 3.04CX LogD: 3.02
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.14Np Likeness Score: -0.28

References

1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M.  (2020)  Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease.,  63  (21): [PMID:33107733] [10.1021/acs.jmedchem.0c01285]

Source