The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-chloro-9-nitro-2-(2-nitrophenylthio)-4-propyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylic acid ID: ALA4794142
PubChem CID: 3125029
Max Phase: Preclinical
Molecular Formula: C22H22ClN3O6S
Molecular Weight: 491.95
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC1Nc2c(C(=O)O)ccc([N+](=O)[O-])c2C2C(Cl)C(Sc3ccccc3[N+](=O)[O-])CC12
Standard InChI: InChI=1S/C22H22ClN3O6S/c1-2-5-13-12-10-17(33-16-7-4-3-6-14(16)25(29)30)20(23)18(12)19-15(26(31)32)9-8-11(22(27)28)21(19)24-13/h3-4,6-9,12-13,17-18,20,24H,2,5,10H2,1H3,(H,27,28)
Standard InChI Key: COGRKLXBUHSTNJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
14.3497 -18.9717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6376 -18.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9256 -19.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9211 -18.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1350 -18.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6537 -19.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1424 -20.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7739 -20.7831 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.3497 -19.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6382 -20.2023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6348 -21.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3420 -21.4320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0543 -21.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0543 -20.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7702 -19.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4842 -20.2064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7710 -18.9681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8287 -19.3959 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.4122 -18.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8213 -17.9700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4056 -17.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5796 -17.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1712 -17.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5894 -18.6930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1822 -19.4138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6022 -20.1240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3573 -19.4224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6397 -17.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3553 -17.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3574 -16.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9151 -21.4303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9116 -22.2554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2024 -21.0148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
3 10 1 0
9 1 1 0
1 2 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 3 1 0
7 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 1 0
15 17 2 0
14 15 1 0
6 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 2 0
25 27 1 0
24 25 1 0
2 28 1 0
28 29 1 0
29 30 1 0
31 32 2 0
31 33 1 0
11 31 1 0
M CHG 4 25 1 27 -1 31 1 33 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.95Molecular Weight (Monoisotopic): 491.0918AlogP: 5.67#Rotatable Bonds: 7Polar Surface Area: 135.61Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.84CX Basic pKa: 0.51CX LogP: 5.94CX LogD: 2.68Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: -0.13
References 1. Hou X,Sun JP,Ge L,Liang X,Li K,Zhang Y,Fang H. (2020) Inhibition of striatal-enriched protein tyrosine phosphatase by targeting computationally revealed cryptic pockets., 190 [PMID:32078861 ] [10.1016/j.ejmech.2020.112131 ]