The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(4-(4-amino-1H-pyrazolo[3,4-d]pyrimidin-3-yl)phenoxy)phenyl)-4-((4-methylpiperazin-1-yl)methyl)-3-(trifluoromethyl)benzamide ID: ALA4794437
PubChem CID: 162674175
Max Phase: Preclinical
Molecular Formula: C31H29F3N8O2
Molecular Weight: 602.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(Cc2ccc(C(=O)Nc3cccc(Oc4ccc(-c5n[nH]c6ncnc(N)c56)cc4)c3)cc2C(F)(F)F)CC1
Standard InChI: InChI=1S/C31H29F3N8O2/c1-41-11-13-42(14-12-41)17-21-6-5-20(15-25(21)31(32,33)34)30(43)38-22-3-2-4-24(16-22)44-23-9-7-19(8-10-23)27-26-28(35)36-18-37-29(26)40-39-27/h2-10,15-16,18H,11-14,17H2,1H3,(H,38,43)(H3,35,36,37,39,40)
Standard InChI Key: QEABUEXAFVUXER-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
35.5547 -19.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5535 -20.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2657 -20.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9795 -20.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9766 -19.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2639 -19.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6869 -19.0450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4003 -19.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8399 -20.6971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9503 -21.6832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7538 -21.5138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5422 -20.9710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0889 -20.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8384 -19.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0375 -19.4145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4875 -20.0280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7451 -20.8033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3899 -18.9780 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4001 -20.2699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1085 -20.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8197 -20.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8140 -19.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1009 -19.0368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5228 -19.0252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.2376 -19.4286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9465 -19.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6595 -19.4221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3679 -19.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3624 -18.1869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6426 -17.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9372 -18.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2436 -20.2499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.6338 -16.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3371 -16.5462 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.9217 -16.5614 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.6260 -16.1416 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
44.0669 -17.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7777 -18.1760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.4823 -17.7620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7840 -18.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1931 -18.1652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1994 -18.9823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.9102 -19.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4948 -19.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
9 13 1 0
12 10 1 0
10 11 1 0
11 9 2 0
2 9 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
14 18 1 0
8 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 8 1 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
25 32 2 0
30 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
29 37 1 0
37 38 1 0
38 39 1 0
38 40 1 0
39 41 1 0
40 44 1 0
41 42 1 0
42 43 1 0
42 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.62Molecular Weight (Monoisotopic): 602.2366AlogP: 5.41#Rotatable Bonds: 7Polar Surface Area: 125.29Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.84CX Basic pKa: 10.14CX LogP: 4.80CX LogD: 4.37Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.23Np Likeness Score: -1.49
References 1. Dong R,Zhou X,Wang M,Li W,Zhang JY,Zheng X,Tang KX,Sun LP. (2021) Discovery of 4-amino-1H-pyrazolo[3,4-d]pyrimidin derivatives as novel discoidin domain receptor 1 (DDR1) inhibitors., 29 [PMID:33246255 ] [10.1016/j.bmc.2020.115876 ]