4-(2,6-difluoro-3-(6-methoxypyridin-3-yl)benzamido)-N-(4-fluorophenyl)-1H-pyrazole-3-carboxamide

ID: ALA4794559

PubChem CID: 162673767

Max Phase: Preclinical

Molecular Formula: C23H16F3N5O3

Molecular Weight: 467.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2ccc(F)c(C(=O)Nc3c[nH]nc3C(=O)Nc3ccc(F)cc3)c2F)cn1

Standard InChI:  InChI=1S/C23H16F3N5O3/c1-34-18-9-2-12(10-27-18)15-7-8-16(25)19(20(15)26)22(32)30-17-11-28-31-21(17)23(33)29-14-5-3-13(24)4-6-14/h2-11H,1H3,(H,28,31)(H,29,33)(H,30,32)

Standard InChI Key:  OSAZCVNAQYUWII-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   33.7511  -12.9595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7499  -13.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4580  -14.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1676  -13.7785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1648  -12.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4562  -12.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8760  -14.1860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8773  -15.0032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5830  -13.7763    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2914  -14.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3762  -14.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1758  -15.1631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.5833  -14.4547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0355  -13.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2029  -13.0485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9793  -12.7935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5938  -12.5036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8710  -12.5446    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.7612  -11.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5370  -11.4531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7045  -10.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0951  -10.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3155  -10.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1517  -11.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0438  -14.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3361  -13.7764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6286  -14.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6275  -15.0019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3398  -15.4109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0445  -15.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2614   -9.3082    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.4578  -15.0052    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.9200  -15.4108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2121  -15.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
  5 18  1  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  2 25  1  0
 22 31  1  0
  3 32  1  0
 28 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4794559

    ---

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1/cyclin B1 (1887 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A2058 (690 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.41Molecular Weight (Monoisotopic): 467.1205AlogP: 4.40#Rotatable Bonds: 6
Polar Surface Area: 109.00Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.28CX Basic pKa: 2.31CX LogP: 4.14CX LogD: 4.14
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.77

References

1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B.  (2021)  Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors.,  215  [PMID:33611192] [10.1016/j.ejmech.2021.113281]

Source