The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2,6-difluoro-3-(6-methoxypyridin-3-yl)benzamido)-N-(4-fluorophenyl)-1H-pyrazole-3-carboxamide ID: ALA4794559
PubChem CID: 162673767
Max Phase: Preclinical
Molecular Formula: C23H16F3N5O3
Molecular Weight: 467.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc(F)c(C(=O)Nc3c[nH]nc3C(=O)Nc3ccc(F)cc3)c2F)cn1
Standard InChI: InChI=1S/C23H16F3N5O3/c1-34-18-9-2-12(10-27-18)15-7-8-16(25)19(20(15)26)22(32)30-17-11-28-31-21(17)23(33)29-14-5-3-13(24)4-6-14/h2-11H,1H3,(H,28,31)(H,29,33)(H,30,32)
Standard InChI Key: OSAZCVNAQYUWII-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
33.7511 -12.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7499 -13.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4580 -14.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1676 -13.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1648 -12.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4562 -12.5506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8760 -14.1860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8773 -15.0032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5830 -13.7763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2914 -14.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3762 -14.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1758 -15.1631 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5833 -14.4547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0355 -13.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2029 -13.0485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9793 -12.7935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5938 -12.5036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8710 -12.5446 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.7612 -11.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5370 -11.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7045 -10.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0951 -10.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3155 -10.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1517 -11.1655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0438 -14.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3361 -13.7764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6286 -14.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6275 -15.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3398 -15.4109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0445 -15.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2614 -9.3082 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.4578 -15.0052 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.9200 -15.4108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2121 -15.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
14 15 1 0
15 16 2 0
15 17 1 0
5 18 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
2 25 1 0
22 31 1 0
3 32 1 0
28 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.41Molecular Weight (Monoisotopic): 467.1205AlogP: 4.40#Rotatable Bonds: 6Polar Surface Area: 109.00Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.28CX Basic pKa: 2.31CX LogP: 4.14CX LogD: 4.14Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.77
References 1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B. (2021) Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors., 215 [PMID:33611192 ] [10.1016/j.ejmech.2021.113281 ]