(10H-Phenoxazin-10-yl)(4-(3-(pyrrolidin-1-yl)propoxy)phenyl)methanone

ID: ALA4794579

PubChem CID: 162673953

Max Phase: Preclinical

Molecular Formula: C26H26N2O3

Molecular Weight: 414.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(OCCCN2CCCC2)cc1)N1c2ccccc2Oc2ccccc21

Standard InChI:  InChI=1S/C26H26N2O3/c29-26(20-12-14-21(15-13-20)30-19-7-18-27-16-5-6-17-27)28-22-8-1-3-10-24(22)31-25-11-4-2-9-23(25)28/h1-4,8-15H,5-7,16-19H2

Standard InChI Key:  GTRNJJUMVMBKFV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   33.7882   -3.7888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7871   -4.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4951   -5.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2048   -4.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2019   -3.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4933   -3.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9131   -5.0153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6202   -4.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3285   -5.0131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0356   -4.6034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7439   -5.0109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0804   -3.3803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3728   -3.7891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0802   -2.5631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.8309   -5.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6305   -5.9902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0380   -5.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4902   -4.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0894   -0.9280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7954   -1.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7912   -2.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4950   -2.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2036   -2.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2039   -1.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4994   -0.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3766   -2.1553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3804   -1.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6699   -0.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9553   -1.3274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9555   -2.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6665   -2.5640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  1 12  1  0
 12 13  2  0
 12 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 11  1  0
 14 21  1  0
 14 26  1  0
 20 19  1  0
 19 27  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4794579

    ---

Associated Targets(Human)

CACNA1B Tclin Voltage-gated N-type calcium channel alpha-1B subunit (743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1H Tclin Voltage-gated T-type calcium channel alpha-1H subunit (1913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.51Molecular Weight (Monoisotopic): 414.1943AlogP: 5.64#Rotatable Bonds: 6
Polar Surface Area: 42.01Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.34CX LogP: 4.44CX LogD: 2.51
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -0.91

References

1. Cardoso FC,Marliac MA,Geoffroy C,Schmit M,Bispat A,Lewis RJ,Tuck KL,Duggan PJ.  (2020)  The neuronal calcium ion channel activity of constrained analogues of MONIRO-1.,  28  (18): [PMID:32828422] [10.1016/j.bmc.2020.115655]

Source