3beta-hydroxyrus-18,20(30)-dien-28-oic acid

ID: ALA479472

PubChem CID: 10718553

Max Phase: Preclinical

Molecular Formula: C30H46O3

Molecular Weight: 454.70

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)C2=C1C

Standard InChI:  InChI=1S/C30H46O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h20-23,31H,1,8-17H2,2-7H3,(H,32,33)/t20-,21+,22-,23+,27+,28-,29-,30+/m1/s1

Standard InChI Key:  DZVARQVBYAEZFI-JZQYXDLISA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    7.8093   -1.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8093   -2.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5218   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5218   -0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2342   -1.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2353   -2.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9468   -2.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6618   -2.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9447   -0.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6564   -1.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6642    0.4034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9455   -0.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3760   -0.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3654   -0.8380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0708   -1.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7911   -0.8565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0920    0.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8026   -0.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5236    0.3657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5401    1.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8295    1.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1022    1.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1011   -3.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9266   -3.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0949   -2.4818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2268   -0.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6486   -0.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3574   -1.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5130   -0.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3939    1.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8445    2.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5135   -1.2660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2272   -0.0357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9398   -1.6511    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2310   -2.8894    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.3699    0.8130    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 16 18  1  0
 17 18  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  3  6  1  0
  5  4  1  0
 17 22  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  5  6  1  0
  3 23  1  0
  3 24  1  0
  9 12  1  0
  2 25  1  1
 10 14  1  0
  5 26  1  1
 13 11  1  0
 10 27  1  1
 11 12  1  0
 14 28  1  6
 13 14  1  0
 18 29  1  1
  1  2  1  0
 22 30  1  0
  1  4  1  0
 21 31  2  0
  2  3  1  0
  5  9  1  0
 29 32  1  0
 29 33  2  0
 13 17  1  0
  9 34  1  6
 14 15  1  0
  6 35  1  6
 15 16  1  0
 13 36  1  1
M  END

Alternative Forms

Associated Targets(non-human)

Polb DNA polymerase beta (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.70Molecular Weight (Monoisotopic): 454.3447AlogP: 7.15#Rotatable Bonds: 1
Polar Surface Area: 57.53Molecular Species: ACIDHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.66CX Basic pKa: CX LogP: 6.19CX LogD: 3.52
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: 2.81

References

1. Deng JZ, Starck SR, Hecht SM..  (1999)  DNA polymerase beta inhibitors from Baeckea gunniana.,  62  (12): [PMID:10654412] [10.1021/np990240w]

Source