N-(4-guanidinophenyl)-6-methyl-2-oxo-2H-chromene-3-carboxamide

ID: ALA4794762

PubChem CID: 162673959

Max Phase: Preclinical

Molecular Formula: C18H16N4O3

Molecular Weight: 336.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2oc(=O)c(C(=O)Nc3ccc(NC(=N)N)cc3)cc2c1

Standard InChI:  InChI=1S/C18H16N4O3/c1-10-2-7-15-11(8-10)9-14(17(24)25-15)16(23)21-12-3-5-13(6-4-12)22-18(19)20/h2-9H,1H3,(H,21,23)(H4,19,20,22)

Standard InChI Key:  MKGOAXOHAYLLFT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    5.3443  -12.0915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3432  -12.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0579  -13.3317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0561  -11.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7715  -12.0878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7704  -12.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4833  -13.3293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2020  -12.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2031  -12.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4856  -11.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9153  -13.3328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9187  -11.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6321  -12.0924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9207  -10.8532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3476  -11.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0574  -12.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7724  -11.6891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7748  -10.8632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0563  -10.4491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3443  -10.8615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4896  -10.4515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4905   -9.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2055   -9.2148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7766   -9.2132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6298  -11.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  8 11  2  0
 12 13  1  0
 12 14  2  0
  9 12  1  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
  1 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4794762

    ---

Associated Targets(Human)

F12 Tchem Coagulation factor XII (1450 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 336.35Molecular Weight (Monoisotopic): 336.1222AlogP: 2.66#Rotatable Bonds: 3
Polar Surface Area: 121.21Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.06CX LogP: 2.29CX LogD: 1.55
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.33Np Likeness Score: -0.81

References

1. Davoine C,Bouckaert C,Fillet M,Pochet L.  (2020)  Factor XII/XIIa inhibitors: Their discovery, development, and potential indications.,  208  [PMID:32883641] [10.1016/j.ejmech.2020.112753]

Source