4-methyl-N-(4-((4-methylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)-3-(pyrazolo[1,5-a]pyrimidin-6-ylethynyl)benzamide

ID: ALA4794765

Cas Number: 1257628-64-0

PubChem CID: 51037822

Max Phase: Preclinical

Molecular Formula: C29H27F3N6O

Molecular Weight: 532.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2ccnn2c1

Standard InChI:  InChI=1S/C29H27F3N6O/c1-20-3-5-23(15-22(20)6-4-21-17-33-27-9-10-34-38(27)18-21)28(39)35-25-8-7-24(26(16-25)29(30,31)32)19-37-13-11-36(2)12-14-37/h3,5,7-10,15-18H,11-14,19H2,1-2H3,(H,35,39)

Standard InChI Key:  FSLXBWOKEGSUPS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    4.7655  -26.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7644  -26.9572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4724  -27.3662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1821  -26.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1793  -26.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4706  -25.7288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0577  -25.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0575  -24.9121    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.3501  -26.1380    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.3472  -25.3205    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.8854  -25.7228    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5947  -26.1288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3008  -25.7175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5977  -26.9460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0085  -26.1268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7142  -25.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7115  -24.8982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9973  -24.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2946  -24.9054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4172  -24.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0564  -27.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0557  -28.1825    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3477  -28.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7631  -28.5916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7624  -29.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3470  -29.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0544  -29.8168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0538  -30.6340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4221  -26.1202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1311  -26.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8401  -26.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8409  -27.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5492  -28.1546    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5424  -26.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2512  -26.9222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2569  -27.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0357  -27.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5113  -27.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0264  -26.6644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  5 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 13  1  0
 17 20  1  0
  2 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 23 26  1  0
 25 27  1  0
 27 26  1  0
 27 28  1  0
 29 30  3  0
 16 29  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 36  1  0
 35 34  1  0
 34 31  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 35  1  0
M  END

Associated Targets(Human)

DDR1 Tchem Epithelial discoidin domain-containing receptor 1 (1050 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 532.57Molecular Weight (Monoisotopic): 532.2198AlogP: 4.46#Rotatable Bonds: 4
Polar Surface Area: 65.77Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.62CX LogP: 5.05CX LogD: 4.62
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.39Np Likeness Score: -1.80

References

1. Dong R,Zhou X,Wang M,Li W,Zhang JY,Zheng X,Tang KX,Sun LP.  (2021)  Discovery of 4-amino-1H-pyrazolo[3,4-d]pyrimidin derivatives as novel discoidin domain receptor 1 (DDR1) inhibitors.,  29  [PMID:33246255] [10.1016/j.bmc.2020.115876]

Source