N-(4-bromophenyl)-2-(5-nitrofuran-2-yl)-1H-benzo[d]imidazole-5-carboxamide

ID: ALA4794786

PubChem CID: 135391702

Max Phase: Preclinical

Molecular Formula: C18H11BrN4O4

Molecular Weight: 427.21

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Br)cc1)c1ccc2[nH]c(-c3ccc([N+](=O)[O-])o3)nc2c1

Standard InChI:  InChI=1S/C18H11BrN4O4/c19-11-2-4-12(5-3-11)20-18(24)10-1-6-13-14(9-10)22-17(21-13)15-7-8-16(27-15)23(25)26/h1-9H,(H,20,24)(H,21,22)

Standard InChI Key:  PZLKASUDHDSDMQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    7.0526   -2.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0513   -3.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7662   -3.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7644   -1.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4797   -2.1713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4846   -2.9977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2720   -3.2485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7540   -2.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2642   -1.9113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5800   -2.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0690   -3.2357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8521   -2.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8472   -2.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0611   -1.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5255   -3.4593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2772   -3.1194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4441   -4.2803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3366   -3.4141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6225   -3.0011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3360   -4.2391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9077   -3.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1944   -2.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4800   -3.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4789   -4.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1981   -4.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9094   -4.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7647   -4.6478    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  8 10  1  0
 15 16  2  0
 15 17  1  0
 12 15  1  0
  2 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA4794786

    ---

Associated Targets(non-human)

Hemozoin (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.21Molecular Weight (Monoisotopic): 425.9964AlogP: 4.75#Rotatable Bonds: 4
Polar Surface Area: 114.06Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.15CX Basic pKa: 2.72CX LogP: 4.23CX LogD: 4.23
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.36Np Likeness Score: -1.81

References

1. Sharma, Mousmee, Prasher, Parteek.  (2020)  An epigrammatic status of the azole-based antimalarial drugs,  11  (2): [PMID:33479627] [10.1039/c9md00479c]

Source