Cis-3-chloro-N-((1R,3S)-3-(5-(1-(2-methoxyethyl)-4-methyl-1H-imidazol-5-yl)-4H-1,2,4-triazol-3-yl)cyclohexyl)-N-methylbenzamide

ID: ALA4794810

PubChem CID: 145444960

Max Phase: Preclinical

Molecular Formula: C23H29ClN6O2

Molecular Weight: 456.98

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCCn1cnc(C)c1-c1nnc([C@H]2CCC[C@@H](N(C)C(=O)c3cccc(Cl)c3)C2)[nH]1

Standard InChI:  InChI=1S/C23H29ClN6O2/c1-15-20(30(14-25-15)10-11-32-3)22-26-21(27-28-22)16-6-5-9-19(13-16)29(2)23(31)17-7-4-8-18(24)12-17/h4,7-8,12,14,16,19H,5-6,9-11,13H2,1-3H3,(H,26,27,28)/t16-,19+/m0/s1

Standard InChI Key:  AMRGLCZZAKTJCX-QFBILLFUSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   30.5704   -3.0211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5704   -3.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2757   -4.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9809   -3.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9809   -3.0211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2757   -2.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8633   -4.2479    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6881   -4.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7688   -5.0606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5679   -5.2317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9776   -4.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4316   -3.9166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7883   -4.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3343   -5.0471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0813   -4.7157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9970   -3.9028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1979   -3.7320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1550   -3.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8645   -5.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1538   -3.0232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4479   -4.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7421   -3.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0355   -4.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0362   -5.0690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7495   -5.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4532   -5.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1634   -5.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7536   -6.2936    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   34.8665   -2.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3477   -2.3245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0163   -1.5775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4975   -0.9170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  2  7  1  6
  4  8  1  6
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  1  0
 11 13  1  0
  7 18  1  0
  7 19  1  0
 18 20  2  0
 18 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 14 27  1  0
 25 28  1  0
 17 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4794810

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.98Molecular Weight (Monoisotopic): 456.2041AlogP: 4.07#Rotatable Bonds: 7
Polar Surface Area: 88.93Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.95CX Basic pKa: 5.00CX LogP: 2.27CX LogD: 2.26
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.58Np Likeness Score: -1.30

References

1.  (2019)  Cyclohexyl benzamide compounds, 

Source