3-(1-benzyl-5-nitro-1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine hydrochloride

ID: ALA4795052

PubChem CID: 3028876

Max Phase: Preclinical

Molecular Formula: C19H23ClN4O3

Molecular Weight: 354.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCCOc1nn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12.Cl

Standard InChI:  InChI=1S/C19H22N4O3.ClH/c1-21(2)11-6-12-26-19-17-13-16(23(24)25)9-10-18(17)22(20-19)14-15-7-4-3-5-8-15;/h3-5,7-10,13H,6,11-12,14H2,1-2H3;1H

Standard InChI Key:  JYMCGKDJPCEFHZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
   18.8571  -17.5312    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.2686  -19.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2675  -20.2261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9822  -20.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9804  -18.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6957  -19.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7006  -20.2261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4924  -20.4783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9769  -19.8031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4845  -19.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7349  -18.3477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7519  -21.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2035  -21.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3990  -21.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8508  -22.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1102  -23.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9228  -23.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4674  -22.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5533  -18.9867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8390  -19.3993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5531  -18.1618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5407  -18.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7910  -17.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5970  -17.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8472  -16.4230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6531  -16.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2916  -15.8133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
 10 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 19 20  2  0
 19 21  1  0
  2 19  1  0
 11 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
M  CHG  2  19   1  21  -1
M  END

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.41Molecular Weight (Monoisotopic): 354.1692AlogP: 3.32#Rotatable Bonds: 8
Polar Surface Area: 73.43Molecular Species: BASEHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.26CX LogP: 3.60CX LogD: 1.75
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.35Np Likeness Score: -1.66

References

1. Ibáñez-Escribano A,Reviriego F,Vela N,Fonseca-Berzal C,Nogal-Ruiz JJ,Arán VJ,Escario JA,Gómez-Barrio A.  (2021)  Promising hit compounds against resistant trichomoniasis: Synthesis and antiparasitic activity of 3-(ω-aminoalkoxy)-1-benzyl-5-nitroindazoles.,  37  [PMID:33556576] [10.1016/j.bmcl.2021.127843]

Source