2-[(2-Aminoimidazolino)-5-(4-guanidino)benzyl]pyridinedihydrochloride

ID: ALA4795084

PubChem CID: 162674097

Max Phase: Preclinical

Molecular Formula: C16H21Cl2N7

Molecular Weight: 309.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.Cl.N=C(N)Nc1ccc(Cc2ccc(NC3=NCCN3)nc2)cc1

Standard InChI:  InChI=1S/C16H19N7.2ClH/c17-15(18)22-13-4-1-11(2-5-13)9-12-3-6-14(21-10-12)23-16-19-7-8-20-16;;/h1-6,10H,7-9H2,(H4,17,18,22)(H2,19,20,21,23);2*1H

Standard InChI Key:  WNWJTBWPAXIPHB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 25  0  0  0  0  0  0  0  0999 V2000
   45.9054  -15.0857    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   37.1826  -12.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1814  -13.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8963  -14.0446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.6127  -13.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6098  -12.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8945  -12.3916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3228  -12.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0388  -12.7953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0386  -13.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7538  -14.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4676  -13.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4619  -12.7832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7461  -12.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1842  -14.0214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.8966  -13.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4666  -14.0437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7524  -13.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8923  -12.7802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.6132  -14.0141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.6657  -12.8122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8589  -12.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4458  -13.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9975  -13.9677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.1705  -12.9643    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  1  0
  3 17  1  0
 17 18  1  0
 16 19  2  0
 16 20  1  0
 18 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 18  1  0
M  END

Associated Targets(Human)

ADRA2A Tclin Adrenergic receptor alpha-2 (812 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 309.38Molecular Weight (Monoisotopic): 309.1702AlogP: 1.35#Rotatable Bonds: 4
Polar Surface Area: 111.21Molecular Species: BASEHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.87CX LogP: 1.72CX LogD: 0.19
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.43Np Likeness Score: -0.53

References

1. McMullan M,Kelly B,Mihigo HB,Keogh AP,Rodriguez F,Brocos-Mosquera I,García-Bea A,Miranda-Azpiazu P,Callado LF,Rozas I.  (2021)  Di-aryl guanidinium derivatives: Towards improved α2-Adrenergic affinity and antagonist activity.,  209  [PMID:33139112] [10.1016/j.ejmech.2020.112947]

Source