N-benzyl-2-{[4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl](methyl)amino}-4-hydroxybutanamide

ID: ALA4795098

PubChem CID: 162674208

Max Phase: Preclinical

Molecular Formula: C26H32N2O2S2

Molecular Weight: 468.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccsc1C(=CCCN(C)C(CCO)C(=O)NCc1ccccc1)c1sccc1C

Standard InChI:  InChI=1S/C26H32N2O2S2/c1-19-12-16-31-24(19)22(25-20(2)13-17-32-25)10-7-14-28(3)23(11-15-29)26(30)27-18-21-8-5-4-6-9-21/h4-6,8-10,12-13,16-17,23,29H,7,11,14-15,18H2,1-3H3,(H,27,30)

Standard InChI Key:  NKRKZXSPGIZNOA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    4.3167   -3.1834    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.1417   -3.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3984   -2.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7292   -1.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0641   -2.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6258   -3.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4464   -3.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2894   -4.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4834   -4.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3963   -5.5913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1496   -5.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7022   -5.3153    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.1835   -2.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8723   -4.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9306   -4.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7511   -4.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2353   -5.0168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0559   -4.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8988   -5.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5401   -5.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3923   -4.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2130   -4.0930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9082   -3.5103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2036   -6.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6878   -7.0209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5493   -3.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3699   -3.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8531   -3.9242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6730   -3.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0102   -3.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5214   -2.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7033   -2.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  2  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
  3 13  1  0
  9 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  2  0
 20 24  1  0
 24 25  1  0
 22 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4795098

    ---

Associated Targets(non-human)

Slc6a11 GABA transporter 4 (930 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a13 GABA transporter 3 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a1 GABA transporter 1 (1980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.69Molecular Weight (Monoisotopic): 468.1905AlogP: 5.25#Rotatable Bonds: 11
Polar Surface Area: 52.57Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.03CX LogP: 5.30CX LogD: 4.58
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -0.50

References

1. Zaręba P,Gryzło B,Malawska K,Sałat K,Höfner GC,Nowaczyk A,Fijałkowski Ł,Rapacz A,Podkowa A,Furgała A,Żmudzki P,Wanner KT,Malawska B,Kulig K.  (2020)  Novel mouse GABA uptake inhibitors with enhanced inhibitory activity toward mGAT3/4 and their effect on pain threshold in mice.,  188  [PMID:31901745] [10.1016/j.ejmech.2019.111920]

Source