((O-(Hydroxy((5-(oleoyloxy)pentyl)oxy)-phosphoryl)-L-serine

ID: ALA4795101

PubChem CID: 162674211

Max Phase: Preclinical

Molecular Formula: C26H50NO8P

Molecular Weight: 535.66

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCCOP(=O)(O)OC[C@H](N)C(=O)O

Standard InChI:  InChI=1S/C26H50NO8P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-25(28)33-21-18-16-19-22-34-36(31,32)35-23-24(27)26(29)30/h9-10,24H,2-8,11-23,27H2,1H3,(H,29,30)(H,31,32)/b10-9-/t24-/m0/s1

Standard InChI Key:  DJEJEZCTGDBUIC-DHSLYTQISA-N

Molfile:  

 
     RDKit          2D

 36 35  0  0  0  0  0  0  0  0999 V2000
    9.4020  -20.5100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4010  -19.6932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0965  -20.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8132  -20.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5097  -20.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2264  -20.5693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9230  -20.9909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6396  -20.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3362  -21.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0528  -20.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6908  -20.9127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0733  -19.8155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3761  -19.3892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6584  -19.7799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9612  -19.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2434  -19.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5462  -19.3181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8284  -19.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1312  -19.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3224  -19.7901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7351  -20.4999    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    4.1436  -19.7876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6137  -20.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3215  -20.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9060  -20.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1983  -20.9127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9060  -19.6869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6137  -21.7299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0292  -20.9127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4446  -20.9127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1523  -20.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8600  -20.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5677  -20.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2754  -20.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9831  -20.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1517  -18.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  1 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 21 20  2  0
 22 21  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  2  0
 23 28  1  6
 24 29  1  0
 29 21  1  0
 21 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 11  1  0
 19 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4795101

    ---

Associated Targets(non-human)

Gpr34 G protein-coupled receptor 34 (411 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
P2ry10 Putative P2Y purinoceptor 10 (276 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.66Molecular Weight (Monoisotopic): 535.3274AlogP: 6.28#Rotatable Bonds: 26
Polar Surface Area: 145.38Molecular Species: ZWITTERIONHBA: 7HBD: 3
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.62CX Basic pKa: 9.38CX LogP: 4.88CX LogD: 1.77
Aromatic Rings: Heavy Atoms: 36QED Weighted: 0.05Np Likeness Score: 0.88

References

1. Nakamura S,Sayama M,Uwamizu A,Jung S,Ikubo M,Otani Y,Kano K,Omi J,Inoue A,Aoki J,Ohwada T.  (2020)  Non-naturally Occurring Regio Isomer of Lysophosphatidylserine Exhibits Potent Agonistic Activity toward G Protein-Coupled Receptors.,  63  (17): [PMID:32787112] [10.1021/acs.jmedchem.0c01126]

Source