The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((O-(Hydroxy((5-(oleoyloxy)pentyl)oxy)-phosphoryl)-L-serine ID: ALA4795101
PubChem CID: 162674211
Max Phase: Preclinical
Molecular Formula: C26H50NO8P
Molecular Weight: 535.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCCOP(=O)(O)OC[C@H](N)C(=O)O
Standard InChI: InChI=1S/C26H50NO8P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-25(28)33-21-18-16-19-22-34-36(31,32)35-23-24(27)26(29)30/h9-10,24H,2-8,11-23,27H2,1H3,(H,29,30)(H,31,32)/b10-9-/t24-/m0/s1
Standard InChI Key: DJEJEZCTGDBUIC-DHSLYTQISA-N
Molfile:
RDKit 2D
36 35 0 0 0 0 0 0 0 0999 V2000
9.4020 -20.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4010 -19.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0965 -20.9279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8132 -20.5378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5097 -20.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2264 -20.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9230 -20.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6396 -20.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3362 -21.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0528 -20.6324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6908 -20.9127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0733 -19.8155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3761 -19.3892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6584 -19.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9612 -19.3537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2434 -19.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5462 -19.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8284 -19.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1312 -19.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3224 -19.7901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7351 -20.4999 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
4.1436 -19.7876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6137 -20.9127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3215 -20.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9060 -20.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1983 -20.9127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9060 -19.6869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6137 -21.7299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 -20.9127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4446 -20.9127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1523 -20.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8600 -20.9127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5677 -20.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2754 -20.9127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9831 -20.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1517 -18.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
1 11 1 0
10 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
21 20 2 0
22 21 1 0
23 24 1 0
23 25 1 0
25 26 1 0
25 27 2 0
23 28 1 6
24 29 1 0
29 21 1 0
21 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 11 1 0
19 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.66Molecular Weight (Monoisotopic): 535.3274AlogP: 6.28#Rotatable Bonds: 26Polar Surface Area: 145.38Molecular Species: ZWITTERIONHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.62CX Basic pKa: 9.38CX LogP: 4.88CX LogD: 1.77Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.05Np Likeness Score: 0.88
References 1. Nakamura S,Sayama M,Uwamizu A,Jung S,Ikubo M,Otani Y,Kano K,Omi J,Inoue A,Aoki J,Ohwada T. (2020) Non-naturally Occurring Regio Isomer of Lysophosphatidylserine Exhibits Potent Agonistic Activity toward G Protein-Coupled Receptors., 63 (17): [PMID:32787112 ] [10.1021/acs.jmedchem.0c01126 ]