3-((4-((2-(diethylamino)ethylamino)methyl)-3,5-dimethyl-1H-pyrrol-2-yl)methylene)-5-(5-(pyridin-3-yl)thiophen-2-yl)indolin-2-one

ID: ALA4795138

PubChem CID: 139377935

Max Phase: Preclinical

Molecular Formula: C31H35N5OS

Molecular Weight: 525.72

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCNCc1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(-c4ccc(-c5cccnc5)s4)cc32)c1C

Standard InChI:  InChI=1S/C31H35N5OS/c1-5-36(6-2)15-14-33-19-26-20(3)28(34-21(26)4)17-25-24-16-22(9-10-27(24)35-31(25)37)29-11-12-30(38-29)23-8-7-13-32-18-23/h7-13,16-18,33-34H,5-6,14-15,19H2,1-4H3,(H,35,37)/b25-17-

Standard InChI Key:  SYXWTMAKZCUMDH-UQQQWYQISA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   33.0581  -11.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0570  -12.7112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7718  -13.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7700  -11.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4854  -11.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4857  -12.7065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2719  -12.9618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7575  -12.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2714  -11.6246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5825  -12.2926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5261  -10.8398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2347  -10.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9898  -10.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5344  -10.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1158   -9.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3126   -9.6019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1693  -11.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4438   -8.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3558  -10.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6987  -10.9598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3481  -11.4717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2637  -10.6563    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.4611  -10.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0490  -11.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5971  -11.8051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8592  -11.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5183  -11.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6802  -11.8699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.0199  -12.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1613  -11.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9823  -11.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8408  -12.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1268   -9.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6149   -9.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2817   -8.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4605   -8.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9737   -8.8964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3096   -9.6477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  2  0
  9 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 13 17  1  0
 15 18  1  0
 14 19  1  0
 19 20  1  0
  1 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  2  0
 20 27  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 29 32  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 23 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4795138

    ---

Associated Targets(Human)

FaDu (1726 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.72Molecular Weight (Monoisotopic): 525.2562AlogP: 6.35#Rotatable Bonds: 10
Polar Surface Area: 73.05Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.16CX Basic pKa: 9.25CX LogP: 5.12CX LogD: 3.27
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.17Np Likeness Score: -0.88

References

1.  (2019)  3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer, 

Source