The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((4-((2-(diethylamino)ethylamino)methyl)-3,5-dimethyl-1H-pyrrol-2-yl)methylene)-5-(5-(pyridin-3-yl)thiophen-2-yl)indolin-2-one ID: ALA4795138
PubChem CID: 139377935
Max Phase: Preclinical
Molecular Formula: C31H35N5OS
Molecular Weight: 525.72
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNCc1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(-c4ccc(-c5cccnc5)s4)cc32)c1C
Standard InChI: InChI=1S/C31H35N5OS/c1-5-36(6-2)15-14-33-19-26-20(3)28(34-21(26)4)17-25-24-16-22(9-10-27(24)35-31(25)37)29-11-12-30(38-29)23-8-7-13-32-18-23/h7-13,16-18,33-34H,5-6,14-15,19H2,1-4H3,(H,35,37)/b25-17-
Standard InChI Key: SYXWTMAKZCUMDH-UQQQWYQISA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
33.0581 -11.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0570 -12.7112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7718 -13.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7700 -11.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4854 -11.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4857 -12.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2719 -12.9618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7575 -12.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2714 -11.6246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5825 -12.2926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5261 -10.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2347 -10.4212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9898 -10.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5344 -10.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1158 -9.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3126 -9.6019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1693 -11.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4438 -8.6657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3558 -10.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6987 -10.9598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3481 -11.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2637 -10.6563 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.4611 -10.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0490 -11.1939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5971 -11.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8592 -11.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5183 -11.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6802 -11.8699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.0199 -12.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1613 -11.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9823 -11.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8408 -12.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1268 -9.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6149 -9.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2817 -8.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4605 -8.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9737 -8.8964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3096 -9.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
13 17 1 0
15 18 1 0
14 19 1 0
19 20 1 0
1 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 2 0
20 27 1 0
26 27 1 0
26 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
29 32 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
23 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 525.72Molecular Weight (Monoisotopic): 525.2562AlogP: 6.35#Rotatable Bonds: 10Polar Surface Area: 73.05Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.16CX Basic pKa: 9.25CX LogP: 5.12CX LogD: 3.27Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.17Np Likeness Score: -0.88
References 1. (2019) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer,