2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl 4-fluorophenylcarbamate

ID: ALA4795256

PubChem CID: 162673969

Max Phase: Preclinical

Molecular Formula: C13H13FN4O4

Molecular Weight: 308.27

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ncc([N+](=O)[O-])n1CCOC(=O)Nc1ccc(F)cc1

Standard InChI:  InChI=1S/C13H13FN4O4/c1-9-15-8-12(18(20)21)17(9)6-7-22-13(19)16-11-4-2-10(14)3-5-11/h2-5,8H,6-7H2,1H3,(H,16,19)

Standard InChI Key:  KGKDAJLIWIRIAB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   11.4583  -10.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2833  -10.4917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5401   -9.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8708   -9.2209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2058   -9.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3251   -9.4537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9731  -11.1602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3076  -11.9144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1527  -11.0730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7675  -11.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5880  -11.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0722  -11.7425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8928  -11.6572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3770  -12.3252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2292  -10.9039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1975  -12.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6776  -12.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4948  -12.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8353  -12.0740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3522  -11.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5287  -11.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6641  -11.9910    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  3  6  1  0
  7  8  2  0
  7  9  1  0
  1  7  1  0
  2 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  2  0
 16 21  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 19 22  1  0
M  CHG  2   7   1   9  -1
M  END

Alternative Forms

  1. Parent:

    ALA4795256

    ---

Associated Targets(non-human)

Giardia intestinalis (1290 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 308.27Molecular Weight (Monoisotopic): 308.0921AlogP: 2.49#Rotatable Bonds: 5
Polar Surface Area: 99.29Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.16CX Basic pKa: 3.27CX LogP: 2.03CX LogD: 2.03
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.68Np Likeness Score: -2.13

References

1. Riches A,Hart CJS,Trenholme KR,Skinner-Adams TS.  (2020)  Anti-Giardia Drug Discovery: Current Status and Gut Feelings.,  63  (22.0): [PMID:32869995] [10.1021/acs.jmedchem.0c00910]

Source